The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-chloro-1-(2,4-dimethoxyphenylsulfonyl)-3-(2-methoxypyridin-3-yl)-3-(4-methyl-3-oxopiperazin-1-yl)indolin-2-one ID: ALA4283895
PubChem CID: 145993226
Max Phase: Preclinical
Molecular Formula: C27H27ClN4O7S
Molecular Weight: 587.05
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N2C(=O)C(c3cccnc3OC)(N3CCN(C)C(=O)C3)c3cc(Cl)ccc32)c(OC)c1
Standard InChI: InChI=1S/C27H27ClN4O7S/c1-30-12-13-31(16-24(30)33)27(19-6-5-11-29-25(19)39-4)20-14-17(28)7-9-21(20)32(26(27)34)40(35,36)23-10-8-18(37-2)15-22(23)38-3/h5-11,14-15H,12-13,16H2,1-4H3
Standard InChI Key: UJRFGBOKSNYQOY-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
21.1022 -2.6587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1022 -3.4759 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8075 -3.8803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5128 -3.4759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5128 -2.6587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8075 -2.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2069 -3.0830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2110 -3.9002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1809 -5.5883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4752 -6.0010 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.1855 -6.4058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0222 -4.1643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0210 -4.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7291 -5.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7273 -3.7555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3144 -3.7559 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19.4359 -4.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4407 -4.9793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2207 -5.2278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6981 -4.5627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5153 -4.5579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9345 -6.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1358 -6.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5928 -7.0559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8497 -7.8326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6547 -7.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1942 -7.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9952 -7.5469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2556 -8.3215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3072 -8.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5067 -8.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9149 -2.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9111 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2008 -1.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4928 -1.8670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5001 -2.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7958 -3.0965 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0847 -2.6938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2199 -3.8855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2217 -2.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
8 7 1 0
10 9 2 0
11 10 2 0
12 13 2 0
13 14 1 0
14 18 2 0
17 15 2 0
15 12 1 0
12 16 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 8 1 0
8 17 1 0
20 21 2 0
19 10 1 0
10 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
27 28 1 0
28 29 1 0
25 30 1 0
30 31 1 0
7 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 7 1 0
36 37 1 0
37 38 1 0
8 2 1 0
4 39 2 0
5 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 587.05Molecular Weight (Monoisotopic): 586.1289AlogP: 2.51#Rotatable Bonds: 7Polar Surface Area: 118.58Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.04CX LogP: 2.42CX LogD: 2.42Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.41Np Likeness Score: -0.86
References 1. Geneste H, Bhowmik S, van Gaalen MM, Hornberger W, Hutchins CW, Netz A, Oost T, Unger L.. (2018) Novel, potent, selective and brain penetrant vasopressin 1b receptor antagonists., 28 (19): [PMID:30098866 ] [10.1016/j.bmcl.2018.07.043 ]