5-chloro-1-(2,4-dimethoxyphenylsulfonyl)-3-(2-methoxypyridin-3-yl)-3-(4-methyl-3-oxopiperazin-1-yl)indolin-2-one

ID: ALA4283895

PubChem CID: 145993226

Max Phase: Preclinical

Molecular Formula: C27H27ClN4O7S

Molecular Weight: 587.05

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)N2C(=O)C(c3cccnc3OC)(N3CCN(C)C(=O)C3)c3cc(Cl)ccc32)c(OC)c1

Standard InChI:  InChI=1S/C27H27ClN4O7S/c1-30-12-13-31(16-24(30)33)27(19-6-5-11-29-25(19)39-4)20-14-17(28)7-9-21(20)32(26(27)34)40(35,36)23-10-8-18(37-2)15-22(23)38-3/h5-11,14-15H,12-13,16H2,1-4H3

Standard InChI Key:  UJRFGBOKSNYQOY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   21.1022   -2.6587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1022   -3.4759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8075   -3.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5128   -3.4759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5128   -2.6587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8075   -2.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2069   -3.0830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2110   -3.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1809   -5.5883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4752   -6.0010    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.1855   -6.4058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0222   -4.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0210   -4.9839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7291   -5.3928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7273   -3.7555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3144   -3.7559    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   19.4359   -4.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4407   -4.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2207   -5.2278    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6981   -4.5627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5153   -4.5579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9345   -6.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1358   -6.4462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5928   -7.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8497   -7.8326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6547   -7.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1942   -7.3851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9952   -7.5469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2556   -8.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3072   -8.4438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5067   -8.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9149   -2.6727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9111   -1.8563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2008   -1.4504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4928   -1.8670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5001   -2.6821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7958   -3.0965    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0847   -2.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2199   -3.8855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2217   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  8  7  1  0
 10  9  2  0
 11 10  2  0
 12 13  2  0
 13 14  1  0
 14 18  2  0
 17 15  2  0
 15 12  1  0
 12 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20  8  1  0
  8 17  1  0
 20 21  2  0
 19 10  1  0
 10 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 27 28  1  0
 28 29  1  0
 25 30  1  0
 30 31  1  0
  7 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36  7  1  0
 36 37  1  0
 37 38  1  0
  8  2  1  0
  4 39  2  0
  5 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4283895

    ---

Associated Targets(Human)

AVPR1B Tclin Vasopressin V1b receptor (1301 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 587.05Molecular Weight (Monoisotopic): 586.1289AlogP: 2.51#Rotatable Bonds: 7
Polar Surface Area: 118.58Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 2.04CX LogP: 2.42CX LogD: 2.42
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.41Np Likeness Score: -0.86

References

1. Geneste H, Bhowmik S, van Gaalen MM, Hornberger W, Hutchins CW, Netz A, Oost T, Unger L..  (2018)  Novel, potent, selective and brain penetrant vasopressin 1b receptor antagonists.,  28  (19): [PMID:30098866] [10.1016/j.bmcl.2018.07.043]

Source