The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((2-Ethyl-6-(pyridin-3-yl)-3H-imidazo[4,5-b]pyridin-7-yl)oxy)-3-fluorophenyl)-1-(4-fluorophenyl)-2-oxo-1,2-dihydropyridine-3-carboxamide ID: ALA4284078
PubChem CID: 145990779
Max Phase: Preclinical
Molecular Formula: C31H22F2N6O3
Molecular Weight: 564.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nc2c(Oc3ccc(NC(=O)c4cccn(-c5ccc(F)cc5)c4=O)cc3F)c(-c3cccnc3)cnc2[nH]1
Standard InChI: InChI=1S/C31H22F2N6O3/c1-2-26-37-27-28(23(17-35-29(27)38-26)18-5-3-13-34-16-18)42-25-12-9-20(15-24(25)33)36-30(40)22-6-4-14-39(31(22)41)21-10-7-19(32)8-11-21/h3-17H,2H2,1H3,(H,36,40)(H,35,37,38)
Standard InChI Key: MNWRYFJTTNZZCL-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
38.5799 -6.2238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5788 -7.0434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2868 -7.4523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2850 -5.8150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9936 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9984 -7.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7785 -7.2873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.2558 -6.6222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7707 -5.9628 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2826 -4.9978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.9891 -4.5871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6959 -4.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4019 -4.5859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3999 -3.7678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6860 -3.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9829 -3.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2723 -3.3704 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
42.1058 -3.3562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.8153 -3.7617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5212 -3.3501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8188 -4.5789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.2279 -3.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9334 -3.3458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.9303 -2.5277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2159 -2.1224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5133 -2.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2301 -4.5740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.6427 -3.7517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6434 -4.5699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.3518 -4.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.0590 -4.5644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.0532 -3.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.3442 -3.3408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.7688 -4.9693 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.8721 -5.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0730 -6.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4858 -7.3226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8753 -4.9973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1683 -4.5889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4598 -4.9977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4626 -5.8192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1701 -6.2238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
16 17 1 0
14 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 20 2 0
22 27 2 0
23 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
1 35 1 0
8 36 1 0
36 37 1 0
35 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 564.55Molecular Weight (Monoisotopic): 564.1721AlogP: 6.06#Rotatable Bonds: 7Polar Surface Area: 114.79Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.81CX Basic pKa: 4.50CX LogP: 4.39CX LogD: 4.39Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.24Np Likeness Score: -1.63
References 1. Baladi T, Aziz J, Dufour F, Abet V, Stoven V, Radvanyi F, Poyer F, Wu TD, Guerquin-Kern JL, Bernard-Pierrot I, Garrido SM, Piguel S.. (2018) Design, synthesis, biological evaluation and cellular imaging of imidazo[4,5-b]pyridine derivatives as potent and selective TAM inhibitors., 26 (20): [PMID:30309671 ] [10.1016/j.bmc.2018.09.031 ]