The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Volasertib ID: ALA4284151
Max Phase: Preclinical
Molecular Formula: C34H50N8O3
Molecular Weight: 618.83
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@H]1C(=O)N(C)c2cnc(Nc3ccc(C(=O)NC4CCC(N5CCN(CC6CC6)CC5)CC4)cc3OC)nc2N1C(C)C
Standard InChI: InChI=1S/C34H50N8O3/c1-6-28-33(44)39(4)29-20-35-34(38-31(29)42(28)22(2)3)37-27-14-9-24(19-30(27)45-5)32(43)36-25-10-12-26(13-11-25)41-17-15-40(16-18-41)21-23-7-8-23/h9,14,19-20,22-23,25-26,28H,6-8,10-13,15-18,21H2,1-5H3,(H,36,43)(H,35,37,38)/t25?,26?,28-/m1/s1
Standard InChI Key: SXNJFOWDRLKDSF-XKHVUIRMSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
15.1841 -5.1343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1841 -5.9515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8894 -6.3559 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8894 -4.7215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8894 -7.1731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1816 -7.5817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5971 -7.5817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8894 -3.9044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4752 -4.7278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4770 -6.3611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7687 -5.9535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5946 -5.1343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5930 -5.9497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2973 -6.3569 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0035 -5.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0012 -5.1315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2964 -4.7279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7117 -6.3579 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4190 -5.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1254 -6.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8322 -5.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8318 -5.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1187 -4.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4148 -5.1356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1245 -7.1763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8317 -7.5856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5386 -4.7221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2472 -5.1291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5367 -3.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9540 -4.7188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6598 -5.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3645 -4.7228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3668 -3.9052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6583 -3.4961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9474 -3.9045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0751 -3.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7790 -3.9105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4852 -3.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4906 -2.6888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7837 -2.2770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0713 -2.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2005 -2.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9060 -2.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3110 -3.4037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7233 -2.6981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 13 1 0
12 4 1 0
3 5 1 0
5 6 1 0
5 7 1 0
4 8 1 0
1 9 2 0
2 10 1 6
10 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
20 25 1 0
25 26 1 0
22 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
33 36 1 0
36 37 1 0
36 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
39 42 1 0
42 43 1 0
44 43 1 0
45 44 1 0
43 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 618.83Molecular Weight (Monoisotopic): 618.4006AlogP: 4.27#Rotatable Bonds: 10Polar Surface Area: 106.17Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.25CX Basic pKa: 8.70CX LogP: 4.20CX LogD: 2.89Aromatic Rings: 2Heavy Atoms: 45QED Weighted: 0.40Np Likeness Score: -1.26
References 1. Pan Z, Chen Y, Liu J, Jiang Q, Yang S, Guo L, He G.. (2018) Design, synthesis, and biological evaluation of polo-like kinase 1/eukaryotic elongation factor 2 kinase (PLK1/EEF2K) dual inhibitors for regulating breast cancer cells apoptosis and autophagy., 144 [PMID:29288948 ] [10.1016/j.ejmech.2017.12.046 ]