The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-({[bis(2-chloroethyl)amino][(1-methyl-2-nitro-1H-imidazol-5-yl)methoxy]phosphoryl}amino)-N-benzyl-N-ethyl-N-methylbutane-1-aminium iodide ID: ALA4284207
PubChem CID: 145992157
Max Phase: Preclinical
Molecular Formula: C23H38Cl2IN6O4P
Molecular Weight: 564.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[N+](C)(CCCCNP(=O)(OCc1cnc([N+](=O)[O-])n1C)N(CCCl)CCCl)Cc1ccccc1.[I-]
Standard InChI: InChI=1S/C23H38Cl2N6O4P.HI/c1-4-31(3,19-21-10-6-5-7-11-21)17-9-8-14-27-36(34,29(15-12-24)16-13-25)35-20-22-18-26-23(28(22)2)30(32)33;/h5-7,10-11,18H,4,8-9,12-17,19-20H2,1-3H3,(H,27,34);1H/q+1;/p-1
Standard InChI Key: FNXUUEIHAHEZAA-UHFFFAOYSA-M
Molfile:
RDKit 2D
37 37 0 0 0 0 0 0 0 0999 V2000
15.3214 -24.6911 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
17.4912 -21.3006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7854 -20.8920 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
14.3751 -20.1574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5579 -20.1573 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3055 -20.9337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9664 -21.4149 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6275 -20.9346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9664 -22.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6039 -21.3527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8902 -20.9546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6159 -22.1698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4047 -21.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0120 -20.6404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3965 -20.3462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7813 -21.7092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0715 -22.1142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1994 -20.8929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9066 -21.3023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6148 -20.8946 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17.4902 -22.1178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1974 -22.5273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0674 -22.9314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3577 -23.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1965 -23.3445 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.3535 -24.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6438 -24.5586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6396 -25.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9381 -24.1465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9335 -24.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2284 -24.5515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5259 -24.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8166 -24.5416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8120 -25.3596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5226 -25.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2290 -25.3650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9294 -25.7787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 4 2 0
7 9 1 0
6 10 1 0
10 11 1 0
10 12 2 0
8 13 1 0
13 14 1 0
14 3 1 0
3 15 2 0
3 16 1 0
16 17 1 0
2 18 1 0
18 19 1 0
19 20 1 0
2 21 1 0
21 22 1 0
17 23 1 0
23 24 1 0
22 25 1 0
24 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
29 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
30 37 1 0
M CHG 4 1 -1 10 1 11 -1 27 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 564.48Molecular Weight (Monoisotopic): 563.2064AlogP: 4.77#Rotatable Bonds: 18Polar Surface Area: 102.53Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.88CX Basic pKa: ┄CX LogP: -0.90CX LogD: -0.90Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.07Np Likeness Score: -0.25
References 1. Ghedira D, Voissière A, Peyrode C, Kraiem J, Gerard Y, Maubert E, Vivier M, Miot-Noirault E, Chezal JM, Farhat F, Weber V.. (2018) Structure-activity relationship study of hypoxia-activated prodrugs for proteoglycan-targeted chemotherapy in chondrosarcoma., 158 [PMID:30199705 ] [10.1016/j.ejmech.2018.08.060 ]