(E)-2-(4-(3-(4-chlorophenyl)acryloyl)phenoxy)-N-(1-oxo-1,3-dihydroisobenzofuran-5-yl)acetamide

ID: ALA4284315

PubChem CID: 145993241

Max Phase: Preclinical

Molecular Formula: C25H18ClNO5

Molecular Weight: 447.87

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(COc1ccc(C(=O)/C=C/c2ccc(Cl)cc2)cc1)Nc1ccc2c(c1)COC2=O

Standard InChI:  InChI=1S/C25H18ClNO5/c26-19-6-1-16(2-7-19)3-12-23(28)17-4-9-21(10-5-17)31-15-24(29)27-20-8-11-22-18(13-20)14-32-25(22)30/h1-13H,14-15H2,(H,27,29)/b12-3+

Standard InChI Key:  YQCAUWWNARBEHI-KGVSQERTSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   32.3038   -2.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3079   -3.5453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0137   -2.3112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7195   -2.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7195   -3.5453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0137   -3.9539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5155   -2.4722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0326   -3.1408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5279   -3.7971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2679   -1.6922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4274   -3.9535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.1349   -3.5444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8428   -3.9526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1344   -2.7273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5503   -3.5436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2582   -3.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2542   -4.7680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9613   -5.1761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6698   -4.7670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6667   -3.9456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9590   -3.5412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3783   -5.1743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3799   -5.9915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.0852   -4.7643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7937   -5.1715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5006   -4.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2055   -5.1715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9119   -4.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9108   -3.9441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1973   -3.5371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4938   -3.9487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6172   -3.5332    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  3  2  0
  5  4  1  0
  6  2  1  0
  7  1  1  0
  8  7  1  0
  9  2  1  0
 10  7  2  0
  8  9  1  0
  6  5  2  0
  5 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4284315

    ---

Associated Targets(Human)

IMPDH2 Tclin Inosine-5'-monophosphate dehydrogenase 2 (1326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.87Molecular Weight (Monoisotopic): 447.0874AlogP: 4.92#Rotatable Bonds: 7
Polar Surface Area: 81.70Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.17CX Basic pKa: CX LogP: 4.80CX LogD: 4.80
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: -0.81

References

1. Shah CP, Kharkar PS..  (2018)  Discovery of novel human inosine 5'-monophosphate dehydrogenase 2 (hIMPDH2) inhibitors as potential anticancer agents.,  158  [PMID:30223117] [10.1016/j.ejmech.2018.09.016]

Source