The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-2-(4-(3-(4-chlorophenyl)acryloyl)phenoxy)-N-(1-oxo-1,3-dihydroisobenzofuran-5-yl)acetamide ID: ALA4284315
PubChem CID: 145993241
Max Phase: Preclinical
Molecular Formula: C25H18ClNO5
Molecular Weight: 447.87
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(COc1ccc(C(=O)/C=C/c2ccc(Cl)cc2)cc1)Nc1ccc2c(c1)COC2=O
Standard InChI: InChI=1S/C25H18ClNO5/c26-19-6-1-16(2-7-19)3-12-23(28)17-4-9-21(10-5-17)31-15-24(29)27-20-8-11-22-18(13-20)14-32-25(22)30/h1-13H,14-15H2,(H,27,29)/b12-3+
Standard InChI Key: YQCAUWWNARBEHI-KGVSQERTSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
32.3038 -2.7198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3079 -3.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0137 -2.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7195 -2.7198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7195 -3.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0137 -3.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5155 -2.4722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0326 -3.1408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5279 -3.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2679 -1.6922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4274 -3.9535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1349 -3.5444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8428 -3.9526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1344 -2.7273 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.5503 -3.5436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.2582 -3.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2542 -4.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9613 -5.1761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6698 -4.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6667 -3.9456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9590 -3.5412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3783 -5.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3799 -5.9915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.0852 -4.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7937 -5.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5006 -4.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2055 -5.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9119 -4.7622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9108 -3.9441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1973 -3.5371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4938 -3.9487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6172 -3.5332 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 3 2 0
5 4 1 0
6 2 1 0
7 1 1 0
8 7 1 0
9 2 1 0
10 7 2 0
8 9 1 0
6 5 2 0
5 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 2 0
22 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.87Molecular Weight (Monoisotopic): 447.0874AlogP: 4.92#Rotatable Bonds: 7Polar Surface Area: 81.70Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.17CX Basic pKa: ┄CX LogP: 4.80CX LogD: 4.80Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: -0.81
References 1. Shah CP, Kharkar PS.. (2018) Discovery of novel human inosine 5'-monophosphate dehydrogenase 2 (hIMPDH2) inhibitors as potential anticancer agents., 158 [PMID:30223117 ] [10.1016/j.ejmech.2018.09.016 ]