N-((9H-pyrido[3,4-b]indol-1-yl)methyl)-2-(2-(2-((9H-pyrido[3,4-b]indol-3-yl)methylamino)ethoxy)ethoxy)ethanamine

ID: ALA4284650

PubChem CID: 145992818

Max Phase: Preclinical

Molecular Formula: C30H32N6O2

Molecular Weight: 508.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  c1ccc2c(c1)[nH]c1cnc(CNCCOCCOCCNCc3nccc4c3[nH]c3ccccc34)cc12

Standard InChI:  InChI=1S/C30H32N6O2/c1-4-8-27-22(5-1)24-9-10-33-29(30(24)36-27)19-32-12-14-38-16-15-37-13-11-31-18-21-17-25-23-6-2-3-7-26(23)35-28(25)20-34-21/h1-10,17,20,31-32,35-36H,11-16,18-19H2

Standard InChI Key:  AKYWVVRNUPTMBE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
    6.8032   -8.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5113   -8.9670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2209   -8.5576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2181   -7.7349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8044   -7.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5054   -7.3272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3309   -6.5334    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1967   -7.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5248   -6.4562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0461   -5.8028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2392   -5.8908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9134   -6.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3941   -7.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9243   -7.3237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6335   -7.7296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3397   -7.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0489   -7.7244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7551   -7.3131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4643   -7.7191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1705   -7.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8797   -7.7138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5859   -7.3026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2951   -7.7086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0013   -7.2973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7106   -7.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4167   -7.2921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1227   -7.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1116   -6.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4088   -6.4776    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8258   -6.4705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8327   -7.2840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5973   -6.2126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0812   -6.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6079   -7.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9418   -8.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7487   -8.3419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2205   -7.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8841   -6.9441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  2  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  6  2  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  4 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 31  1  0
 30 28  1  0
 28 29  2  0
 29 26  1  0
 30 31  2  0
 31 34  1  0
 33 32  1  0
 32 30  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4284650

    ---

Associated Targets(Human)

IMR-90 (216 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A-375 (9258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H1299 (3248 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 508.63Molecular Weight (Monoisotopic): 508.2587AlogP: 4.66#Rotatable Bonds: 13
Polar Surface Area: 99.88Molecular Species: BASEHBA: 6HBD: 4
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.72CX Basic pKa: 8.54CX LogP: 2.76CX LogD: 0.97
Aromatic Rings: 6Heavy Atoms: 38QED Weighted: 0.17Np Likeness Score: -0.16

References

1. Kumar S, Singh A, Kumar K, Kumar V..  (2017)  Recent insights into synthetic β-carbolines with anti-cancer activities.,  142  [PMID:28583770] [10.1016/j.ejmech.2017.05.059]

Source