The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-bromo-2-((4-oxo-3-(pyridin-2-ylmethyl)-2-thioxothiazolidin-5-ylidene)methyl)phenoxy)acetic acid ID: ALA4284695
PubChem CID: 145991031
Max Phase: Preclinical
Molecular Formula: C18H13BrN2O4S2
Molecular Weight: 465.35
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)COc1ccc(Br)cc1/C=C1\SC(=S)N(Cc2ccccn2)C1=O
Standard InChI: InChI=1S/C18H13BrN2O4S2/c19-12-4-5-14(25-10-16(22)23)11(7-12)8-15-17(24)21(18(26)27-15)9-13-3-1-2-6-20-13/h1-8H,9-10H2,(H,22,23)/b15-8-
Standard InChI Key: DZPVIZZFQXTDHO-NVNXTCNLSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
2.6978 -3.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6966 -4.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4047 -4.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1144 -4.1043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1115 -3.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4029 -2.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4045 -5.3309 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
3.4005 -2.0592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6915 -1.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9851 -2.0634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2761 -1.6569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9875 -2.8806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8177 -2.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5261 -3.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5300 -4.0935 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.3090 -4.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7867 -3.6786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3027 -3.0193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5652 -5.1185 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.5515 -2.2409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6038 -3.6746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0158 -4.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6078 -5.0880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0191 -5.7933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8371 -5.7898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2421 -5.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8285 -4.3728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
6 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
5 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
16 19 2 0
18 20 2 0
17 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.35Molecular Weight (Monoisotopic): 463.9500AlogP: 3.71#Rotatable Bonds: 6Polar Surface Area: 79.73Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.80CX Basic pKa: 4.14CX LogP: 2.36CX LogD: 0.16Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.51Np Likeness Score: -2.13
References 1. Lough L, Sherman D, Ni E, Young LM, Hao B, Cardozo T.. (2018) Chemical probes of Skp2-mediated p27 ubiquitylation and degradation., 9 (7): [PMID:30108998 ] [10.1039/C8MD00140E ]