The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,6-bis(1-(2,4-difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethoxy)hexane ID: ALA4284744
PubChem CID: 145993034
Max Phase: Preclinical
Molecular Formula: C26H28F4N6O2
Molecular Weight: 532.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Fc1ccc(C(Cn2cncn2)OCCCCCCOC(Cn2cncn2)c2ccc(F)cc2F)c(F)c1
Standard InChI: InChI=1S/C26H28F4N6O2/c27-19-5-7-21(23(29)11-19)25(13-35-17-31-15-33-35)37-9-3-1-2-4-10-38-26(14-36-18-32-16-34-36)22-8-6-20(28)12-24(22)30/h5-8,11-12,15-18,25-26H,1-4,9-10,13-14H2
Standard InChI Key: HPYRHKYHJZPMAX-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
37.5729 -4.7545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5717 -5.5741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2798 -5.9830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9894 -5.5736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9866 -4.7509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2780 -4.3457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2796 -6.8002 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.6928 -4.3397 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.2755 -3.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9820 -3.1178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.6910 -3.5243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5666 -3.1220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8626 -4.3499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8604 -3.5371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.0867 -3.2880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6106 -3.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0902 -4.6031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.3974 -3.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1064 -3.5200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8128 -3.1093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5218 -3.5158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5694 -4.4010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8790 -4.8425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9170 -5.6593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6448 -6.0356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3357 -5.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2943 -4.7738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2290 -6.1003 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
44.0631 -5.9614 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
43.9808 -4.3305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7079 -4.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9402 -3.5143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.3945 -4.2602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.1551 -4.5525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6711 -3.9188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.2278 -3.2322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4380 -3.4417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.2285 -3.1052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
5 8 1 0
6 9 1 0
9 10 1 0
10 11 1 0
9 12 1 0
12 14 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 2 0
11 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
24 28 1 0
26 29 1 0
27 30 1 0
30 31 1 0
30 32 1 0
31 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 33 1 0
21 38 1 0
38 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.54Molecular Weight (Monoisotopic): 532.2210AlogP: 5.20#Rotatable Bonds: 15Polar Surface Area: 79.88Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.31CX LogP: 4.77CX LogD: 4.77Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.15Np Likeness Score: -0.78
References 1. Zhang Y, Damu GLV, Cui SF, Mi JL, Tangadanchu VKR, Zhou CH.. (2017) Discovery of potential antifungal triazoles: design, synthesis, biological evaluation, and preliminary antifungal mechanism exploration., 8 (8): [PMID:30108874 ] [10.1039/C7MD00112F ]