(2R,3S)-3-((S)-2-((S)-2-acetamido-3-(1-(8-phenyloctyl)-1H-imidazol-5-yl)propanamido)-3-hydroxypropanamido)-4-amino-4-oxobutan-2-yl dihydrogen phosphate

ID: ALA4285090

PubChem CID: 71468090

Max Phase: Preclinical

Molecular Formula: C29H45N6O9P

Molecular Weight: 652.69

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](Cc1cncn1CCCCCCCCc1ccccc1)C(=O)N[C@@H](CO)C(=O)N[C@H](C(N)=O)[C@@H](C)OP(=O)(O)O

Standard InChI:  InChI=1S/C29H45N6O9P/c1-20(44-45(41,42)43)26(27(30)38)34-29(40)25(18-36)33-28(39)24(32-21(2)37)16-23-17-31-19-35(23)15-11-6-4-3-5-8-12-22-13-9-7-10-14-22/h7,9-10,13-14,17,19-20,24-26,36H,3-6,8,11-12,15-16,18H2,1-2H3,(H2,30,38)(H,32,37)(H,33,39)(H,34,40)(H2,41,42,43)/t20-,24+,25+,26+/m1/s1

Standard InChI Key:  RLKOZTUQTILVBD-CHQQOIJLSA-N

Molfile:  

     RDKit          2D

 45 46  0  0  0  0  0  0  0  0999 V2000
    4.2603  -14.3646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6820  -14.3667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9709  -14.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9699  -15.5925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6791  -15.9971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3909  -15.5885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1027  -15.9971    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3909  -14.7672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8146  -15.5885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5264  -15.9971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8146  -14.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5264  -14.3545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2382  -15.5885    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5264  -16.8185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9501  -15.9971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6619  -15.5885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3696  -15.9971    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6619  -14.7672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9501  -16.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2382  -17.2312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6619  -17.2312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6619  -18.0525    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   11.3696  -18.4611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9501  -18.4611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3664  -17.6315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6791  -16.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9714  -17.2312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2229  -16.8998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6720  -17.5071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0847  -18.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8881  -18.0489    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4961  -18.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2730  -18.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8809  -18.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6578  -18.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2658  -19.1802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0427  -18.9268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6506  -19.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4817  -20.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0896  -20.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9153  -21.6172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5225  -22.1630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3003  -21.9097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4676  -21.1055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8591  -20.5632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  1  0
  1  3  1  0
  3  2  2  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  1
 11 12  1  0
 10 13  1  0
 10 14  2  0
 13 15  1  0
 15 16  1  6
 16 17  1  0
 16 18  2  0
 15 19  1  0
 19 20  1  6
 19 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 22 25  1  0
  5  4  1  0
  5 26  1  6
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 27  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  2  0
 41 42  1  0
 42 43  2  0
 43 44  1  0
 44 45  2  0
 45 40  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4285090

   [(2R,3S)-3-[[(2S)-2-[[(2S)-2-acetamido-3-[3-(8-phenyloctyl)imidazol-4-yl]propanoyl]amino]-3-hydroxypropanoyl]amino]-4-amino-4-oxobutan-2-yl] dihydrogen phosphate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 652.69

Molecular Weight (Monoisotopic): 652.2986

AlogP: 0.46

#Rotatable Bonds: 21

Polar Surface Area: 235.20

Molecular Species: ACID

HBA: 9

HBD: 7

#RO5 Violations: 2

HBA (Lipinski): 15

HBD (Lipinski): 8

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 1.35

CX Basic pKa: 6.51

CX LogP: -2.06

CX LogD: -3.64

Aromatic Rings: 2

Heavy Atoms: 45

QED Weighted: 0.07

Np Likeness Score: -0.03

References

1. Hymel D, Grant RA, Tsuji K, Yaffe MB, Burke TR..  (2018)  Histidine N(τ)-cyclized macrocycles as a new genre of polo-like kinase 1 polo-box domain-binding inhibitors.,  28  (19): [PMID:30174151] [10.1016/j.bmcl.2018.08.018]

Source

Source(1):

• Scientific Literature