2-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethyl-hexadecyl]-6-methyl-3,5-bis(trideuteriomethyl)benzene-1,4-diol

ID: ALA4285348

PubChem CID: 145990185

Max Phase: Preclinical

Molecular Formula: C29H52O3

Molecular Weight: 448.73

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  [2H]C([2H])([2H])c1c(C)c(O)c(CC[C@](C)(O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)c(C([2H])([2H])[2H])c1O

Standard InChI:  InChI=1S/C29H52O3/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8,32)19-17-26-25(7)27(30)23(5)24(6)28(26)31/h20-22,30-32H,9-19H2,1-8H3/t21-,22-,29-/m1/s1/i5D3,7D3

Standard InChI Key:  JOURHZSBLWSODQ-BCHQTGRQSA-N

Molfile:  

     RDKit          2D

 38 38  0  0  0  0  0  0  0  0999 V2000
   19.1141  -13.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4536  -14.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8167  -14.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7421  -14.8896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0329  -14.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7968  -16.9107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2101  -13.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0309  -13.7578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1586  -14.8938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7968  -16.0939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5006  -14.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7968  -14.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6185  -14.4687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2062  -16.0991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2080  -14.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6910  -14.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1117  -14.4959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0848  -14.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5711  -14.8980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3773  -14.4667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0848  -15.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2785  -14.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9836  -14.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4560  -13.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8660  -14.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3255  -14.8854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2809  -13.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5006  -15.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9131  -14.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4043  -14.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7989  -13.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5076  -13.2364    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0922  -13.2328    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7922  -12.8233    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3795  -16.1065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6694  -15.7021    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3842  -16.9237    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6667  -16.5089    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
 19 22  1  0
 28 14  1  0
 23 16  1  0
 11 15  1  0
 15 29  1  0
 22 27  1  6
 21 10  1  0
 11 12  2  0
 16 30  1  0
 13 26  1  0
 18 20  1  0
 26  5  1  0
  2 24  1  6
 10 28  2  0
 28 11  1  0
 17  3  1  0
 30 17  1  0
 25 19  1  0
  8 13  1  0
 17  1  1  0
 22 23  1  0
  2  9  1  0
 18 12  1  0
  4  2  1  0
  5  4  1  0
 13  7  1  1
 29 13  1  0
 10  6  1  0
 18 21  2  0
  9 25  1  0
 12 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
 21 35  1  0
 35 36  1  0
 35 37  1  0
 35 38  1  0
M  ISO  6  32   2  33   2  34   2  36   2  37   2  38   2
M  END

Associated Targets(Human)

CYP4F2 Tchem Cytochrome P450 4F2 (83 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.73Molecular Weight (Monoisotopic): 448.3916AlogP: 8.15#Rotatable Bonds: 15
Polar Surface Area: 60.69Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.53CX Basic pKa: CX LogP: 9.84CX LogD: 9.84
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.24Np Likeness Score: 1.11

References

1. Taylor L, Krueger N, Malysheva O, Atkinson J, Parker RS..  (2018)  ω-Hydroxylation of α-tocopheryl quinone reveals a dual function for cytochrome P450-4F2 in vitamin E metabolism.,  26  (20): [PMID:30316641] [10.1016/j.bmc.2018.10.002]

Source