The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-chloro-3-(2-methoxyphenyl)-1-(2-methoxyphenylsulfonyl)-3-(4-(pyridin-3-yl)piperazin-1-yl)indolin-2-one ID: ALA4285386
PubChem CID: 145991740
Max Phase: Preclinical
Molecular Formula: C31H29ClN4O5S
Molecular Weight: 605.12
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1C1(N2CCN(c3cccnc3)CC2)C(=O)N(S(=O)(=O)c2ccccc2OC)c2ccc(Cl)cc21
Standard InChI: InChI=1S/C31H29ClN4O5S/c1-40-27-10-4-3-9-24(27)31(35-18-16-34(17-19-35)23-8-7-15-33-21-23)25-20-22(32)13-14-26(25)36(30(31)37)42(38,39)29-12-6-5-11-28(29)41-2/h3-15,20-21H,16-19H2,1-2H3
Standard InChI Key: TXDFHOMIDMZXIU-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
20.9702 -13.0510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9702 -13.8682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6755 -14.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3807 -13.8682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3807 -13.0510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6755 -12.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0748 -13.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0790 -14.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0489 -15.9806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3431 -16.3934 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.0534 -16.7982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8901 -14.5567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8890 -15.3762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5970 -15.7852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5952 -14.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1823 -14.1483 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19.3039 -14.5531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3086 -15.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0887 -15.6202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5660 -14.9550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3832 -14.9502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8024 -17.0063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0038 -16.8386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4607 -17.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7176 -18.2249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5226 -18.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0621 -17.7775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8631 -17.9393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1235 -18.7139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7828 -13.0651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7790 -12.2486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0687 -11.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3607 -12.2594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3680 -13.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6637 -13.4889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9526 -13.0861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0896 -12.6445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7923 -13.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5007 -12.6525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5035 -11.8344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7921 -11.4239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0865 -11.8321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
8 7 1 0
10 9 2 0
11 10 2 0
12 13 2 0
13 14 1 0
14 18 2 0
17 15 2 0
15 12 1 0
12 16 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 8 1 0
8 17 1 0
20 21 2 0
19 10 1 0
10 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
27 28 1 0
28 29 1 0
7 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 7 1 0
34 35 1 0
35 36 1 0
8 2 1 0
5 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 605.12Molecular Weight (Monoisotopic): 604.1547AlogP: 4.55#Rotatable Bonds: 7Polar Surface Area: 92.28Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.59CX LogP: 4.78CX LogD: 4.77Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.30Np Likeness Score: -0.99
References 1. Geneste H, Bhowmik S, van Gaalen MM, Hornberger W, Hutchins CW, Netz A, Oost T, Unger L.. (2018) Novel, potent, selective and brain penetrant vasopressin 1b receptor antagonists., 28 (19): [PMID:30098866 ] [10.1016/j.bmcl.2018.07.043 ]