The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-(4-(3-acetamidophenyl)thiazol-2-yl)-N8-(2-aminophenyl)octanediamide ID: ALA4285537
PubChem CID: 145990601
Max Phase: Preclinical
Molecular Formula: C25H29N5O3S
Molecular Weight: 479.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1cccc(-c2csc(NC(=O)CCCCCCC(=O)Nc3ccccc3N)n2)c1
Standard InChI: InChI=1S/C25H29N5O3S/c1-17(31)27-19-10-8-9-18(15-19)22-16-34-25(29-22)30-24(33)14-5-3-2-4-13-23(32)28-21-12-7-6-11-20(21)26/h6-12,15-16H,2-5,13-14,26H2,1H3,(H,27,31)(H,28,32)(H,29,30,33)
Standard InChI Key: KNDBVKRRTUJIHZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
13.6961 -0.0278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4105 -0.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4105 -1.2653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1250 -0.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8395 -0.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5539 -0.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2684 -0.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9829 -0.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6974 -0.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4118 -0.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1263 -0.4403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4118 0.7972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8408 -0.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9816 -0.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2279 -0.1047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6759 -0.7178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0884 -1.4323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8953 -1.2607 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.5552 -0.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2697 -0.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2697 0.7972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5552 1.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8408 0.7972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8554 -0.6316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5198 0.1221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6994 0.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2144 -0.4591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5500 -1.2128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3705 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1263 1.2097 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3638 0.9620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8487 1.6295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5132 2.3831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6692 1.5432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
1 14 1 0
15 14 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 14 1 0
19 13 2 0
20 19 1 0
21 20 2 0
22 21 1 0
23 22 2 0
13 23 1 0
24 16 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
24 29 1 0
29 28 2 0
23 30 1 0
26 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.61Molecular Weight (Monoisotopic): 479.1991AlogP: 5.27#Rotatable Bonds: 11Polar Surface Area: 126.21Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.96CX Basic pKa: 3.45CX LogP: 4.03CX LogD: 3.93Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.22Np Likeness Score: -1.50
References 1. Adhikari N, Amin SA, Trivedi P, Jha T, Ghosh B.. (2018) HDAC3 is a potential validated target for cancer: An overview on the benzamide-based selective HDAC3 inhibitors through comparative SAR/QSAR/QAAR approaches., 157 [PMID:30179749 ] [10.1016/j.ejmech.2018.08.081 ] 2. Sarkar R, Banerjee S, Amin SA, Adhikari N, Jha T.. (2020) Histone deacetylase 3 (HDAC3) inhibitors as anticancer agents: A review., 192 [PMID:32163814 ] [10.1016/j.ejmech.2020.112171 ]