(S)-2-(4-(2,4-dioxo-1,2-dihydroquinazolin-3(4H)-yl)butanamido)-3-methylbutanoic acid

ID: ALA4286047

PubChem CID: 1791645

Max Phase: Preclinical

Molecular Formula: C17H21N3O5

Molecular Weight: 347.37

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)[C@H](NC(=O)CCCn1c(=O)[nH]c2ccccc2c1=O)C(=O)O

Standard InChI:  InChI=1S/C17H21N3O5/c1-10(2)14(16(23)24)19-13(21)8-5-9-20-15(22)11-6-3-4-7-12(11)18-17(20)25/h3-4,6-7,10,14H,5,8-9H2,1-2H3,(H,18,25)(H,19,21)(H,23,24)/t14-/m0/s1

Standard InChI Key:  WOVSOUGNKRKOSI-AWEZNQCLSA-N

Molfile:  

     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
   38.2167  -15.8980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2156  -16.7176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9236  -17.1265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6333  -16.7171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9218  -15.4892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6296  -15.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3309  -15.4872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3307  -14.6720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.6230  -14.2662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9155  -14.6757    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.0393  -15.8946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.6213  -13.4491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.0377  -14.2622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7461  -14.6697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4532  -14.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1615  -14.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8686  -14.2576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.1629  -15.4845    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.5769  -14.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5783  -15.4822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2867  -15.8897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.8712  -15.8920    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.2840  -14.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.9924  -14.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2826  -13.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  1  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  7 11  2  0
  9 12  2  0
  8 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
 19 23  1  1
 23 24  1  0
 23 25  1  0
M  END

Associated Targets(non-human)

aroQ 3-dehydroquinate dehydratase (50 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 347.37Molecular Weight (Monoisotopic): 347.1481AlogP: 0.70#Rotatable Bonds: 7
Polar Surface Area: 121.26Molecular Species: ACIDHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.56CX Basic pKa: CX LogP: 1.98CX LogD: -1.38
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.68Np Likeness Score: -0.80

References

1. Marchand JR, Caflisch A..  (2018)  In silico fragment-based drug design with SEED.,  156  [PMID:30064119] [10.1016/j.ejmech.2018.07.042]

Source