The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(4-(2,4-dioxo-1,2-dihydroquinazolin-3(4H)-yl)butanamido)-3-methylbutanoic acid ID: ALA4286047
PubChem CID: 1791645
Max Phase: Preclinical
Molecular Formula: C17H21N3O5
Molecular Weight: 347.37
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@H](NC(=O)CCCn1c(=O)[nH]c2ccccc2c1=O)C(=O)O
Standard InChI: InChI=1S/C17H21N3O5/c1-10(2)14(16(23)24)19-13(21)8-5-9-20-15(22)11-6-3-4-7-12(11)18-17(20)25/h3-4,6-7,10,14H,5,8-9H2,1-2H3,(H,18,25)(H,19,21)(H,23,24)/t14-/m0/s1
Standard InChI Key: WOVSOUGNKRKOSI-AWEZNQCLSA-N
Molfile:
RDKit 2D
25 26 0 0 0 0 0 0 0 0999 V2000
38.2167 -15.8980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2156 -16.7176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9236 -17.1265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6333 -16.7171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9218 -15.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6296 -15.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3309 -15.4872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3307 -14.6720 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6230 -14.2662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9155 -14.6757 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.0393 -15.8946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.6213 -13.4491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.0377 -14.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7461 -14.6697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4532 -14.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1615 -14.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8686 -14.2576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.1629 -15.4845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.5769 -14.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5783 -15.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2867 -15.8897 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.8712 -15.8920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.2840 -14.2553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9924 -14.6627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2826 -13.4381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 1 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
7 11 2 0
9 12 2 0
8 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 1 0
20 21 2 0
20 22 1 0
19 23 1 1
23 24 1 0
23 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 347.37Molecular Weight (Monoisotopic): 347.1481AlogP: 0.70#Rotatable Bonds: 7Polar Surface Area: 121.26Molecular Species: ACIDHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.56CX Basic pKa: ┄CX LogP: 1.98CX LogD: -1.38Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.68Np Likeness Score: -0.80