2-(4-(2-(4-(ethylsulfonyl)phenyl)acetamido)phenyl)-N-(2-fluorophenyl)-2-methylpropanamide

ID: ALA4286190

PubChem CID: 145990013

Max Phase: Preclinical

Molecular Formula: C26H27FN2O4S

Molecular Weight: 482.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(C)(C)C(=O)Nc3ccccc3F)cc2)cc1

Standard InChI:  InChI=1S/C26H27FN2O4S/c1-4-34(32,33)21-15-9-18(10-16-21)17-24(30)28-20-13-11-19(12-14-20)26(2,3)25(31)29-23-8-6-5-7-22(23)27/h5-16H,4,17H2,1-3H3,(H,28,30)(H,29,31)

Standard InChI Key:  MEJYFHSTMVGYPM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    4.8536  -17.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8577  -18.6344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5634  -18.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5191  -17.9163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9318  -18.6262    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.3402  -17.9138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5662  -19.0430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5651  -19.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2731  -20.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9828  -19.8621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9799  -19.0394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2713  -18.6341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6911  -20.2695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3982  -19.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1065  -20.2673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3969  -19.0426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8136  -19.8576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5207  -20.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2272  -19.8574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2264  -19.0394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5131  -18.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8094  -19.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6418  -19.0353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3483  -18.6246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1508  -19.0433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4430  -18.6349    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1510  -19.8605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7354  -19.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0281  -18.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3210  -19.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3207  -19.8596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0335  -20.2679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7377  -19.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0290  -17.8163    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20  5  1  0
  5 23  1  0
 23 24  1  0
  7  2  1  0
  2 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 29 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4286190

    ---

Associated Targets(Human)

RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.58Molecular Weight (Monoisotopic): 482.1676AlogP: 4.72#Rotatable Bonds: 8
Polar Surface Area: 92.34Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.67CX Basic pKa: CX LogP: 4.71CX LogD: 4.71
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.49Np Likeness Score: -1.92

References

1. Sasaki Y, Odan M, Yamamoto S, Kida S, Ueyama A, Shimizu M, Haruna T, Watanabe A, Okuno T..  (2018)  Discovery of a potent orally bioavailable retinoic acid receptor-related orphan receptor-gamma-t (RORγt) inhibitor, S18-000003.,  28  (22): [PMID:30301676] [10.1016/j.bmcl.2018.09.032]

Source