The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[4-(1H-Imidazol-1-yl)butoxy]-4-nitro-N-[4-methyl-3-[[4-(pyridin-3-yl)pyrimidin-2-yl]amino]phenyl]benzamide ID: ALA4286253
PubChem CID: 145992224
Max Phase: Preclinical
Molecular Formula: C30H28N8O4
Molecular Weight: 564.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)c2ccc([N+](=O)[O-])c(OCCCCn3ccnc3)c2)cc1Nc1nccc(-c2cccnc2)n1
Standard InChI: InChI=1S/C30H28N8O4/c1-21-6-8-24(18-26(21)36-30-33-12-10-25(35-30)23-5-4-11-31-19-23)34-29(39)22-7-9-27(38(40)41)28(17-22)42-16-3-2-14-37-15-13-32-20-37/h4-13,15,17-20H,2-3,14,16H2,1H3,(H,34,39)(H,33,35,36)
Standard InChI Key: SMUIUUIKJMXBAL-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
1.3812 -25.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3801 -25.8346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0881 -26.2436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7978 -25.8342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7949 -25.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0863 -24.6062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0898 -27.0586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3803 -27.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3798 -28.2829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0879 -28.6925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7981 -28.2796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7952 -27.4646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5011 -24.6002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2103 -25.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2101 -25.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9185 -26.2269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6256 -25.8156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6199 -24.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9109 -24.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9212 -27.0441 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9036 -23.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6302 -27.4503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6329 -28.2675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3366 -27.0394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9247 -28.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9271 -29.4936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6366 -29.9007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3453 -29.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3395 -28.6703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0558 -29.8891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7607 -29.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4712 -29.8795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1761 -29.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8866 -29.8699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5915 -29.4564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3394 -29.7828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8821 -29.1718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4686 -28.4669 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6705 -28.6423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6413 -30.7222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3509 -31.1275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9355 -31.1341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
5 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
16 20 1 0
19 21 1 0
20 22 1 0
22 23 1 0
22 24 2 0
23 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 23 1 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 35 1 0
40 41 2 0
40 42 1 0
27 40 1 0
M CHG 2 40 1 42 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 564.61Molecular Weight (Monoisotopic): 564.2234AlogP: 5.81#Rotatable Bonds: 12Polar Surface Area: 149.99Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.67CX Basic pKa: 6.53CX LogP: 4.86CX LogD: 4.81Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.11Np Likeness Score: -1.91
References 1. Sorrenti V, Pittalà V, Romeo G, Amata E, Dichiara M, Marrazzo A, Turnaturi R, Prezzavento O, Barbagallo I, Vanella L, Rescifina A, Floresta G, Tibullo D, Di Raimondo F, Intagliata S, Salerno L.. (2018) Targeting heme Oxygenase-1 with hybrid compounds to overcome Imatinib resistance in chronic myeloid leukemia cell lines., 158 [PMID:30261468 ] [10.1016/j.ejmech.2018.09.048 ]