The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 7-benzyl-1-(4-chlorobenzyl)-5-phenyl-4,5,6,7-tetrahydro-1H-[1,2,3]triazolo[4,5-c]pyridine-7-carboxylate ID: ALA4286429
PubChem CID: 145992018
Max Phase: Preclinical
Molecular Formula: C28H27ClN4O2
Molecular Weight: 487.00
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1(Cc2ccccc2)CN(c2ccccc2)Cc2nnn(Cc3ccc(Cl)cc3)c21
Standard InChI: InChI=1S/C28H27ClN4O2/c1-2-35-27(34)28(17-21-9-5-3-6-10-21)20-32(24-11-7-4-8-12-24)19-25-26(28)33(31-30-25)18-22-13-15-23(29)16-14-22/h3-16H,2,17-20H2,1H3
Standard InChI Key: XQGQSPHXERIITE-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
27.2024 -8.1660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7950 -8.8737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2024 -9.5814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7950 -10.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2658 -9.6654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4645 -9.8067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1841 -10.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3786 -10.7171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8494 -10.0892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1299 -9.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9353 -9.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0872 -10.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0872 -11.5200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3753 -11.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6675 -11.5200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9597 -11.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9597 -12.7466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6675 -13.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3753 -12.7466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7950 -11.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5027 -11.5200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2810 -11.7742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.7624 -11.1084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2810 -10.4467 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5353 -9.6683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3371 -9.4993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8847 -10.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6823 -9.9357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9366 -9.1573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7384 -8.9884 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.3890 -8.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5872 -8.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5027 -10.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0215 -9.5814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7950 -7.4541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
6 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
6 11 2 0
4 12 1 0
13 12 1 0
14 13 1 0
14 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
14 19 2 0
13 20 1 0
20 21 1 0
22 21 1 0
23 22 2 0
24 23 1 0
25 24 1 0
26 25 1 0
26 27 1 0
28 27 2 0
29 28 1 0
30 29 1 0
31 29 2 0
32 31 1 0
26 32 2 0
24 33 1 0
33 4 1 0
21 33 2 0
3 34 2 0
1 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.00Molecular Weight (Monoisotopic): 486.1823AlogP: 5.04#Rotatable Bonds: 7Polar Surface Area: 60.25Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 0.26CX LogP: 6.24CX LogD: 6.24Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -0.88
References 1. Karypidou K, Ribone SR, Quevedo MA, Persoons L, Pannecouque C, Helsen C, Claessens F, Dehaen W.. (2018) Synthesis, biological evaluation and molecular modeling of a novel series of fused 1,2,3-triazoles as potential anti-coronavirus agents., 28 (21): [PMID:30286952 ] [10.1016/j.bmcl.2018.09.019 ]