(E)-2-(4-cinnamoylphenoxy)-N-(1-oxo-1,3-dihydroisobenzofuran-5-yl)acetamide

ID: ALA4286567

PubChem CID: 145990435

Max Phase: Preclinical

Molecular Formula: C25H19NO5

Molecular Weight: 413.43

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(COc1ccc(C(=O)/C=C/c2ccccc2)cc1)Nc1ccc2c(c1)COC2=O

Standard InChI:  InChI=1S/C25H19NO5/c27-23(13-6-17-4-2-1-3-5-17)18-7-10-21(11-8-18)30-16-24(28)26-20-9-12-22-19(14-20)15-31-25(22)29/h1-14H,15-16H2,(H,26,28)/b13-6+

Standard InChI Key:  BAHNGXMLPIARCG-AWNIVKPZSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    3.7888  -19.6374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7929  -20.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4987  -19.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2044  -19.6374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2044  -20.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4987  -20.8714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0005  -19.3897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5176  -20.0583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0129  -20.7146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7529  -18.6097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9124  -20.8710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6199  -20.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3278  -20.8701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6194  -19.6448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0353  -20.4611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7432  -20.8693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7392  -21.6855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4463  -22.0936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1548  -21.6845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1516  -20.8631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4440  -20.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8633  -22.0918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8648  -22.9090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5702  -21.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2787  -22.0891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9856  -21.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6905  -22.0890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3969  -21.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3958  -20.8616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6823  -20.4546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9788  -20.8662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  3  2  0
  5  4  1  0
  6  2  1  0
  7  1  1  0
  8  7  1  0
  9  2  1  0
 10  7  2  0
  8  9  1  0
  6  5  2  0
  5 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4286567

    ---

Associated Targets(Human)

IMPDH2 Tclin Inosine-5'-monophosphate dehydrogenase 2 (1326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABCG2 Tchem ATP-binding cassette sub-family G member 2 (4927 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 413.43Molecular Weight (Monoisotopic): 413.1263AlogP: 4.27#Rotatable Bonds: 7
Polar Surface Area: 81.70Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.17CX Basic pKa: CX LogP: 4.20CX LogD: 4.20
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.36Np Likeness Score: -0.67

References

1. Shah CP, Kharkar PS..  (2018)  Discovery of novel human inosine 5'-monophosphate dehydrogenase 2 (hIMPDH2) inhibitors as potential anticancer agents.,  158  [PMID:30223117] [10.1016/j.ejmech.2018.09.016]
2. Silbermann K, Shah CP, Sahu NU, Juvale K, Stefan SM, Kharkar PS, Wiese M..  (2019)  Novel chalcone and flavone derivatives as selective and dual inhibitors of the transport proteins ABCB1 and ABCG2.,  164  [PMID:30594677] [10.1016/j.ejmech.2018.12.019]

Source