(E)-N-(3,4-dimethoxyphenyl)-2-(4-(3-(thiophen-2-yl)acryloyl)phenoxy)acetamide

ID: ALA4286876

PubChem CID: 145993343

Max Phase: Preclinical

Molecular Formula: C23H21NO5S

Molecular Weight: 423.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(NC(=O)COc2ccc(C(=O)/C=C/c3cccs3)cc2)cc1OC

Standard InChI:  InChI=1S/C23H21NO5S/c1-27-21-12-7-17(14-22(21)28-2)24-23(26)15-29-18-8-5-16(6-9-18)20(25)11-10-19-4-3-13-30-19/h3-14H,15H2,1-2H3,(H,24,26)/b11-10+

Standard InChI Key:  LNQSBOCWWLGIGG-ZHACJKMWSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    3.5948   -2.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5989   -3.0830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3047   -1.8490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0105   -2.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0105   -3.0830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3047   -3.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7184   -3.4912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4259   -3.0822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1338   -3.4904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4254   -2.2650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8413   -3.0813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5492   -3.4895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5452   -4.3058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2523   -4.7139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9608   -4.3048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9577   -3.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2500   -3.0790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6693   -4.7120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6709   -5.5292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3762   -4.3021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0847   -4.7093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7916   -4.2993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8864   -1.8503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8920   -3.4930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8849   -1.0331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1835   -3.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5387   -4.6268    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.0843   -4.0184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6743   -3.3114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8754   -3.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  3  2  0
  5  4  1  0
  6  2  1  0
  6  5  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
  1 23  1  0
  2 24  1  0
 23 25  1  0
 24 26  1  0
 22 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 22  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4286876

    ---

Associated Targets(Human)

IMPDH2 Tclin Inosine-5'-monophosphate dehydrogenase 2 (1326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.49Molecular Weight (Monoisotopic): 423.1140AlogP: 4.68#Rotatable Bonds: 9
Polar Surface Area: 73.86Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.61CX Basic pKa: CX LogP: 4.24CX LogD: 4.24
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.40Np Likeness Score: -1.57

References

1. Shah CP, Kharkar PS..  (2018)  Discovery of novel human inosine 5'-monophosphate dehydrogenase 2 (hIMPDH2) inhibitors as potential anticancer agents.,  158  [PMID:30223117] [10.1016/j.ejmech.2018.09.016]

Source