The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-6-bromo-8-methoxy-4-(2-(3-methoxyphenyl)-2-oxoethyl)-4H-chromene-3-carbonitrile ID: ALA4287063
PubChem CID: 145990454
Max Phase: Preclinical
Molecular Formula: C20H17BrN2O4
Molecular Weight: 429.27
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(C(=O)CC2C(C#N)=C(N)Oc3c(OC)cc(Br)cc32)c1
Standard InChI: InChI=1S/C20H17BrN2O4/c1-25-13-5-3-4-11(6-13)17(24)9-14-15-7-12(21)8-18(26-2)19(15)27-20(23)16(14)10-22/h3-8,14H,9,23H2,1-2H3
Standard InChI Key: IDUWPNGPJLPBOS-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
29.2139 -13.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2128 -13.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9275 -14.3271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9257 -12.6741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6410 -13.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6445 -13.9116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3597 -14.3207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0760 -13.9058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0726 -13.0774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3528 -12.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7916 -14.3164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3483 -11.8388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6316 -11.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6271 -10.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9194 -11.8467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3398 -10.1911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3357 -9.3668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6184 -8.9575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9039 -9.3783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9117 -10.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7863 -12.6603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4983 -12.2410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9280 -15.1520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2139 -15.5649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4994 -12.6746 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
32.0481 -8.9508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7645 -9.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
8 11 1 0
10 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 14 1 0
9 21 1 0
21 22 3 0
3 23 1 0
23 24 1 0
1 25 1 0
17 26 1 0
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.27Molecular Weight (Monoisotopic): 428.0372AlogP: 3.91#Rotatable Bonds: 5Polar Surface Area: 94.57Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.45CX LogP: 3.23CX LogD: 3.23Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.72Np Likeness Score: -0.62
References 1. Pontes O, Costa M, Santos F, Sampaio-Marques B, Dias T, Ludovico P, Baltazar F, Proença F.. (2018) Exploitation of new chalcones and 4H-chromenes as agents for cancer treatment., 157 [PMID:30081238 ] [10.1016/j.ejmech.2018.07.058 ]