The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Acetyl-cyclo[Histidinyl-[N(tue)-5-pentyl]-[N(pi)-8-phenyloctyl]-Seryl-(O-phospho)-Threonylamide] ID: ALA4287557
PubChem CID: 145990069
Max Phase: Preclinical
Molecular Formula: C34H54N6O9P+
Molecular Weight: 721.81
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N[C@H]1Cc2c[n+](cn2CCCCCCCCc2ccccc2)CCCCCNC(=O)[C@H]([C@@H](C)OP(=O)(O)O)NC(=O)[C@H](CO)NC1=O
Standard InChI: InChI=1S/C34H53N6O9P/c1-25(49-50(46,47)48)31-34(45)35-18-12-8-13-19-39-22-28(21-29(36-26(2)42)32(43)37-30(23-41)33(44)38-31)40(24-39)20-14-6-4-3-5-9-15-27-16-10-7-11-17-27/h7,10-11,16-17,22,24-25,29-31,41H,3-6,8-9,12-15,18-21,23H2,1-2H3,(H5-,35,36,37,38,42,43,44,45,46,47,48)/p+1/t25-,29+,30+,31+/m1/s1
Standard InChI Key: BXUVUZFLIDJEID-CNKGAEGWSA-O
Molfile:
RDKit 2D
50 52 0 0 0 0 0 0 0 0999 V2000
7.9278 -16.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3467 -16.4180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6233 -16.8050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5964 -17.6251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2904 -18.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9898 -17.6233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6852 -18.0277 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9898 -16.8185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3846 -17.6233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0800 -18.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3846 -16.8185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0800 -16.4181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7794 -17.6233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0800 -18.8325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2904 -18.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5124 -19.6046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0181 -20.2412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4706 -20.9065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2727 -19.8814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4747 -18.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1742 -17.6233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4747 -18.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7794 -19.2370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1742 -19.2370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8695 -18.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1742 -16.8185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8695 -16.4181 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
14.8695 -15.6133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5648 -16.8185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8622 -17.2188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7794 -20.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7002 -20.6815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2137 -20.2146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8366 -19.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0323 -19.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6510 -18.7673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8467 -18.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4655 -18.0325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6611 -18.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2840 -17.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4796 -17.2710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1019 -16.5586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2983 -16.5317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8743 -17.2180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2557 -17.9287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0581 -17.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0053 -21.4272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3078 -22.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2932 -21.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2469 -20.6891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
1 3 1 0
3 2 2 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
9 10 1 0
9 11 1 1
11 12 1 0
10 13 1 0
10 14 2 0
5 4 1 6
5 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 50 2 0
50 19 1 0
19 16 2 0
13 20 1 0
20 21 1 0
20 22 1 1
22 23 1 0
22 24 2 0
21 25 1 6
21 26 1 0
26 27 1 0
27 28 2 0
27 29 1 0
27 30 1 0
23 31 1 0
31 32 1 0
17 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 41 1 0
32 47 1 0
47 48 1 0
48 49 1 0
49 50 1 0
M CHG 1 50 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 721.81Molecular Weight (Monoisotopic): 721.3684AlogP: 1.17#Rotatable Bonds: 14Polar Surface Area: 212.20Molecular Species: ACIDHBA: 8HBD: 7#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.34CX Basic pKa: ┄CX LogP: -2.78CX LogD: -5.01Aromatic Rings: 2Heavy Atoms: 50QED Weighted: 0.08Np Likeness Score: 0.68
References 1. Hymel D, Grant RA, Tsuji K, Yaffe MB, Burke TR.. (2018) Histidine N(τ)-cyclized macrocycles as a new genre of polo-like kinase 1 polo-box domain-binding inhibitors., 28 (19): [PMID:30174151 ] [10.1016/j.bmcl.2018.08.018 ]