The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(-)-Dactylolide ID: ALA4288175
PubChem CID: 11222845
Max Phase: Preclinical
Molecular Formula: C23H28O5
Molecular Weight: 384.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=C1C[C@@H]2C/C=C/C(=O)C/C(C)=C\C=C\C(=O)O[C@H](C=O)C/C(C)=C/[C@H](C1)O2
Standard InChI: InChI=1S/C23H28O5/c1-16-6-4-9-23(26)28-22(15-24)14-18(3)13-21-12-17(2)11-20(27-21)8-5-7-19(25)10-16/h4-7,9,13,15,20-22H,2,8,10-12,14H2,1,3H3/b7-5+,9-4+,16-6-,18-13+/t20-,21-,22-/m0/s1
Standard InChI Key: JSRXONXXGPZPDD-WVXVWMMWSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
6.1496 -14.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8549 -13.7932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5601 -14.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9722 -14.2119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2657 -13.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1496 -15.0231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4505 -15.4294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4506 -16.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9687 -15.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6648 -16.2550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6723 -15.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1558 -16.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1542 -17.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9554 -16.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9478 -17.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5385 -17.4474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8590 -17.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8761 -18.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5712 -19.0337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2507 -18.6216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2351 -17.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6821 -13.8071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3824 -15.0331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5877 -19.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8628 -16.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4407 -13.7994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7422 -15.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7410 -14.2047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8512 -17.0413 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.2297 -17.0042 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.4438 -14.6104 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 6 1 0
1 2 1 0
3 2 2 0
3 5 1 0
9 4 1 0
4 5 2 0
7 6 1 0
7 8 1 0
8 12 1 0
9 11 1 0
14 10 2 0
10 11 1 0
12 13 2 0
13 17 1 0
14 15 1 0
21 15 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
4 22 1 0
11 23 2 0
19 24 2 0
12 25 1 0
1 26 2 0
7 27 1 0
27 28 2 0
17 29 1 6
21 30 1 6
7 31 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 384.47Molecular Weight (Monoisotopic): 384.1937AlogP: 3.96#Rotatable Bonds: 1Polar Surface Area: 69.67Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.65CX LogD: 3.65Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.39Np Likeness Score: 2.76
References 1. Cao YN, Zheng LL, Wang D, Liang XX, Gao F, Zhou XL.. (2018) Recent advances in microtubule-stabilizing agents., 143 [PMID:29223097 ] [10.1016/j.ejmech.2017.11.062 ] 2. Taufa T, Singh AJ, Harland CR, Patel V, Jones B, Halafihi TI, Miller JH, Keyzers RA, Northcote PT.. (2018) Zampanolides B-E from the Marine Sponge Cacospongia mycofijiensis: Potent Cytotoxic Macrolides with Microtubule-Stabilizing Activity., 81 (11): [PMID:30371079 ] [10.1021/acs.jnatprod.8b00641 ] 3. Henry JL, Wilson MR, Mulligan MP, Quinn TR, Sackett DL, Taylor RE.. (2019) Synthesis, conformational preferences, and biological activity of conformational analogues of the microtubule-stabilizing agents, (-)-zampanolide and (-)-dactylolide., 10 (5): [PMID:31191870 ] [10.1039/C9MD00164F ]