The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-{2-[2-(2-Acetylamino-3-phenyl-propionylamino)-5-guanidino-pentanoylamino]-3-hydroxy-propionylamino}-3-methyl-butyrylamino)-pentanedioic acid diamide ID: ALA428820
PubChem CID: 14999602
Max Phase: Preclinical
Molecular Formula: C30H48N10O8
Molecular Weight: 676.78
Molecule Type: Protein
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(N)=O)C(C)C
Standard InChI: InChI=1S/C30H48N10O8/c1-16(2)24(29(48)37-19(25(32)44)11-12-23(31)43)40-28(47)22(15-41)39-26(45)20(10-7-13-35-30(33)34)38-27(46)21(36-17(3)42)14-18-8-5-4-6-9-18/h4-6,8-9,16,19-22,24,41H,7,10-15H2,1-3H3,(H2,31,43)(H2,32,44)(H,36,42)(H,37,48)(H,38,46)(H,39,45)(H,40,47)(H4,33,34,35)/t19-,20-,21-,22-,24-/m0/s1
Standard InChI Key: DXABQJRMDPXFMC-YGQNSOCVSA-N
Molfile:
RDKit 2D
48 48 0 0 1 0 0 0 0 0999 V2000
10.8125 -5.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4042 -5.8917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7000 -6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5875 -5.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2917 -6.3000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9917 -5.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1042 -6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5167 -6.3000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1750 -5.8917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7667 -5.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2917 -9.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9292 -6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0625 -6.3000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2250 -5.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8792 -6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3542 -5.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9292 -3.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9917 -9.9625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8125 -5.0750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7000 -7.1125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -7.1125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5875 -5.0750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7667 -5.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9292 -7.1125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3417 -5.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6292 -3.4500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2250 -5.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2917 -8.7375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5875 -9.9625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6292 -5.8917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1042 -7.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9292 -4.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2250 -3.4500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1750 -4.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9917 -5.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7000 -4.6667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6500 -6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8792 -7.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5875 -8.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8125 -7.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4042 -7.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0000 -4.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -3.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5875 -7.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1542 -2.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4042 -3.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9875 -2.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 8 1 0
3 2 1 0
4 10 1 0
5 6 1 0
6 7 1 0
7 3 1 0
8 1 1 0
9 1 1 0
10 16 1 0
11 4 1 0
12 29 2 0
13 15 1 0
14 11 1 0
15 9 1 0
16 5 1 0
17 14 1 0
18 33 1 0
19 12 1 0
20 1 2 0
21 3 2 0
22 4 2 0
23 5 2 0
11 24 1 1
25 13 2 0
26 17 2 0
27 18 2 0
15 28 1 1
29 40 1 0
30 12 1 0
31 13 1 0
8 32 1 6
33 28 1 0
34 18 1 0
35 24 1 0
7 36 1 1
37 36 1 0
38 17 1 0
16 39 1 6
40 45 1 0
41 32 1 0
42 32 1 0
43 35 2 0
44 35 1 0
45 39 1 0
46 44 2 0
47 43 1 0
48 46 1 0
47 48 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 676.78Molecular Weight (Monoisotopic): 676.3657AlogP: -3.87#Rotatable Bonds: 21Polar Surface Area: 316.31Molecular Species: BASEHBA: 9HBD: 10#RO5 Violations: 2HBA (Lipinski): 18HBD (Lipinski): 14#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.65CX Basic pKa: 10.76CX LogP: -4.61CX LogD: -6.71Aromatic Rings: 1Heavy Atoms: 48QED Weighted: 0.03Np Likeness Score: 0.28
References 1. Deshpande MS, Burton J.. (1992) Mapping the binding site of tissue kallikrein: preparation and testing of all possible substrate analog inhibitors homologous with the sequence of kininogen between Ser386 and Gln392., 35 (17): [PMID:1507198 ] [10.1021/jm00095a002 ]