4-(5-Chloro-2-(((1r,4r)-4-((2-methoxyethyl)amino)cyclohexyl)oxy)pyridin-4-yl)-N-((tetrahydro-2H-pyran-4-yl)methyl)thiazol-2-amine

ID: ALA4288265

PubChem CID: 145990727

Max Phase: Preclinical

Molecular Formula: C23H33ClN4O3S

Molecular Weight: 481.06

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCN[C@H]1CC[C@H](Oc2cc(-c3csc(NCC4CCOCC4)n3)c(Cl)cn2)CC1

Standard InChI:  InChI=1S/C23H33ClN4O3S/c1-29-11-8-25-17-2-4-18(5-3-17)31-22-12-19(20(24)14-26-22)21-15-32-23(28-21)27-13-16-6-9-30-10-7-16/h12,14-18,25H,2-11,13H2,1H3,(H,27,28)/t17-,18-

Standard InChI Key:  FAGIQTPYWXLICC-IYARVYRRSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   33.7310  -28.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7310  -29.2642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0178  -29.6728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3046  -29.2642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3046  -28.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0178  -28.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4401  -28.0301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5996  -29.6728    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1732  -29.6728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8864  -29.2642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4641  -29.2642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7509  -29.6728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1533  -28.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8666  -28.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5757  -28.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5757  -29.2642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8666  -29.6728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1533  -29.2642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.1795  -27.0448    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   38.5881  -27.7539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0362  -28.3645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2847  -28.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3729  -27.2115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2847  -29.6728    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   39.4068  -27.7515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.8216  -28.4621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6429  -28.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0491  -29.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8669  -29.1704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2813  -28.4592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.8677  -27.7468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0437  -27.7456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  1  7  1  1
  4  8  1  6
  9 10  1  0
 11 12  1  0
  9 11  1  0
  8 10  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 19 23  1  0
 15 22  1  0
 16 24  1  0
  7 13  1  0
 20 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4288265

    ---

Associated Targets(Human)

CDK9 Tchem CDK9/Cyclin K (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 481.06Molecular Weight (Monoisotopic): 480.1962AlogP: 4.62#Rotatable Bonds: 10
Polar Surface Area: 77.53Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.09CX LogP: 3.76CX LogD: 1.18
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -1.29

References

1. Wang B, Wu J, Wu Y, Chen C, Zou F, Wang A, Wu H, Hu Z, Jiang Z, Liu Q, Wang W, Zhang Y, Liu F, Zhao M, Hu J, Huang T, Ge J, Wang L, Ren T, Wang Y, Liu J, Liu Q..  (2018)  Discovery of 4-(((4-(5-chloro-2-(((1s,4s)-4-((2-methoxyethyl)amino)cyclohexyl)amino)pyridin-4-yl)thiazol-2-yl)amino)methyl)tetrahydro-2H-pyran-4-carbonitrile (JSH-150) as a novel highly selective and potent CDK9 kinase inhibitor.,  158  [PMID:30253346] [10.1016/j.ejmech.2018.09.025]

Source