4-((S)-3-((S)-2-((R)-4-fluoro-2,3-dihydro-1H-inden-1-ylcarbamoyl)pyrrolidin-1-yl)-2-((S)-2-(methylamino)propanamido)-3-oxopropyl)benzenesulfonate

ID: ALA4288451

PubChem CID: 145991404

Max Phase: Preclinical

Molecular Formula: C27H33FN4O6S

Molecular Weight: 560.65

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN[C@@H](C)C(=O)N[C@@H](Cc1ccc(S(=O)(=O)O)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H]1CCc2c(F)cccc21

Standard InChI:  InChI=1S/C27H33FN4O6S/c1-16(29-2)25(33)31-23(15-17-8-10-18(11-9-17)39(36,37)38)27(35)32-14-4-7-24(32)26(34)30-22-13-12-19-20(22)5-3-6-21(19)28/h3,5-6,8-11,16,22-24,29H,4,7,12-15H2,1-2H3,(H,30,34)(H,31,33)(H,36,37,38)/t16-,22+,23-,24-/m0/s1

Standard InChI Key:  WOIZNLWOYISVQN-ZFIFVKQDSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    6.5128  -17.3426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2227  -17.7512    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.2216  -16.9321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2952  -18.7195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5135  -19.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3052  -19.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8793  -19.1293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6563  -18.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8650  -18.1367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3839  -20.9654    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9617  -21.5432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6898  -21.1723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5620  -20.3651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7549  -20.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8437  -21.3749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5514  -20.9663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1360  -20.9663    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4282  -21.3749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8437  -22.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2591  -21.3749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5514  -20.1491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9668  -20.9663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6745  -21.3749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9668  -20.1491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6745  -22.1921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8338  -22.3503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0709  -22.6432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4689  -22.8646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2318  -22.5718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2598  -21.7346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4438  -21.7774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5527  -22.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9170  -23.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0442  -23.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8066  -24.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4423  -23.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3118  -22.7874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9454  -22.2713    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.0186  -17.9532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 10  1  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 15 19  1  6
 16 20  1  0
 16 21  2  0
 20 22  1  0
 22 23  1  0
 22 24  1  1
 24  5  1  0
 23 10  1  0
 23 25  2  0
 11 26  1  1
 26 27  2  0
 26 28  1  0
 29 28  1  6
 29 33  1  0
 32 30  1  0
 30 31  1  0
 31 29  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 37 38  1  0
  8  2  1  0
  2 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4288451

    ---

Associated Targets(Human)

BIRC3 Tchem Baculoviral IAP repeat-containing protein 3 (320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BIRC2 Tchem Baculoviral IAP repeat-containing protein 2 (984 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
XIAP Tchem Inhibitor of apoptosis protein 3 (3673 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 560.65Molecular Weight (Monoisotopic): 560.2105AlogP: 1.50#Rotatable Bonds: 9
Polar Surface Area: 144.91Molecular Species: ZWITTERIONHBA: 6HBD: 4
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: -2.16CX Basic pKa: 8.60CX LogP: 0.50CX LogD: 0.48
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.34Np Likeness Score: -0.64

References

1. Baggio C, Gambini L, Udompholkul P, Salem AF, Aronson A, Dona A, Troadec E, Pichiorri F, Pellecchia M..  (2018)  Design of Potent pan-IAP and Lys-Covalent XIAP Selective Inhibitors Using a Thermodynamics Driven Approach.,  61  (14): [PMID:29940121] [10.1021/acs.jmedchem.8b00810]

Source