The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(1,1-dioxido-3-oxobenzo[d]isothiazol-2(3H)-yl)acetamido)phenyl-4-(nitrooxy)butanoate ID: ALA4289108
PubChem CID: 145989466
Max Phase: Preclinical
Molecular Formula: C19H17N3O9S
Molecular Weight: 463.42
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CN1C(=O)c2ccccc2S1(=O)=O)Nc1ccc(OC(=O)CCCO[N+](=O)[O-])cc1
Standard InChI: InChI=1S/C19H17N3O9S/c23-17(12-21-19(25)15-4-1-2-5-16(15)32(21,28)29)20-13-7-9-14(10-8-13)31-18(24)6-3-11-30-22(26)27/h1-2,4-5,7-10H,3,6,11-12H2,(H,20,23)
Standard InChI Key: KQEAMSGRPIHTFC-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
34.9783 -1.6839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9824 -2.5011 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.6880 -2.0889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7935 -2.7611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7924 -3.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5004 -3.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4987 -2.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2073 -2.7575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2075 -3.5761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9862 -3.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4672 -3.1664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2389 -4.6060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2844 -3.1657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6924 -2.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5096 -2.4569 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2832 -1.7503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.9188 -3.1643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5076 -3.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9161 -4.5753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7342 -4.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1420 -3.8620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7311 -3.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1443 -5.2819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.9615 -5.2801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3717 -5.9869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.3686 -4.5715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1858 -4.5697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5928 -3.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4100 -3.8593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.8170 -3.1507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.6342 -3.1489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.4069 -2.4439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 2 1 0
2 8 1 0
10 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
23 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
M CHG 2 30 1 31 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.42Molecular Weight (Monoisotopic): 463.0686AlogP: 1.36#Rotatable Bonds: 9Polar Surface Area: 162.22Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.82CX Basic pKa: ┄CX LogP: 1.60CX LogD: 1.60Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.19Np Likeness Score: -1.54
References 1. Das M, Bhattacharjee S, Fronczek FR, Bazan NG, Trudell ML.. (2018) Synthesis, hepatotoxic evaluation and antipyretic activity of nitrate ester analogs of the acetaminophen derivative SCP-1., 28 (23-24): [PMID:30327145 ] [10.1016/j.bmcl.2018.09.020 ]