(E)-N-(3,4-dimethoxyphenyl)-2-(4-(3-(3-methoxyphenyl)acryloyl)phenoxy)acetamide

ID: ALA4289201

PubChem CID: 145986566

Max Phase: Preclinical

Molecular Formula: C26H25NO6

Molecular Weight: 447.49

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1cccc(/C=C/C(=O)c2ccc(OCC(=O)Nc3ccc(OC)c(OC)c3)cc2)c1

Standard InChI:  InChI=1S/C26H25NO6/c1-30-22-6-4-5-18(15-22)7-13-23(28)19-8-11-21(12-9-19)33-17-26(29)27-20-10-14-24(31-2)25(16-20)32-3/h4-16H,17H2,1-3H3,(H,27,29)/b13-7+

Standard InChI Key:  RNRVTSXHRJZLKK-NTUHNPAUSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   18.3455  -19.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3497  -20.0047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0554  -18.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7612  -19.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7612  -20.0047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0554  -20.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4691  -20.4128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1766  -20.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8845  -20.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1761  -19.1866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5920  -20.0030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3000  -20.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2959  -21.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0031  -21.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7115  -21.2264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7084  -20.4050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0007  -20.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4200  -21.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4216  -22.4508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1269  -21.2237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8354  -21.6309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5423  -21.2210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2472  -21.6308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9537  -21.2216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9525  -20.4035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2390  -19.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5355  -20.4081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6371  -18.7719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6427  -20.4146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6356  -17.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9342  -20.0074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6620  -21.6291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.6631  -22.4463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  3  2  0
  5  4  1  0
  6  2  1  0
  6  5  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  1 28  1  0
  2 29  1  0
 28 30  1  0
 29 31  1  0
 24 32  1  0
 32 33  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4289201

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 447.49

Molecular Weight (Monoisotopic): 447.1682

AlogP: 4.63

#Rotatable Bonds: 10

Polar Surface Area: 83.09

Molecular Species: NEUTRAL

HBA: 6

HBD: 1

#RO5 Violations: ┄

HBA (Lipinski): 7

HBD (Lipinski): 1

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 12.61

CX Basic pKa: ┄

CX LogP: 4.17

CX LogD: 4.17

Aromatic Rings: 3

Heavy Atoms: 33

QED Weighted: 0.36

Np Likeness Score: -0.91

References

1. Shah CP, Kharkar PS..  (2018)  Discovery of novel human inosine 5'-monophosphate dehydrogenase 2 (hIMPDH2) inhibitors as potential anticancer agents.,  158  [PMID:30223117] [10.1016/j.ejmech.2018.09.016]

2. Silbermann K, Shah CP, Sahu NU, Juvale K, Stefan SM, Kharkar PS, Wiese M..  (2019)  Novel chalcone and flavone derivatives as selective and dual inhibitors of the transport proteins ABCB1 and ABCG2.,  164  [PMID:30594677] [10.1016/j.ejmech.2018.12.019]

Source

Source(1):

• Scientific Literature