The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Bromo-4-[4-(1H-imidazol-1-yl)butoxy]-N-[4-methyl-3-[[4-(pyridin-3-yl)pyrimidin-2-yl]amino]phenyl]benzamide ID: ALA4289670
PubChem CID: 145987069
Max Phase: Preclinical
Molecular Formula: C30H28BrN7O2
Molecular Weight: 598.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)c2ccc(OCCCCn3ccnc3)c(Br)c2)cc1Nc1nccc(-c2cccnc2)n1
Standard InChI: InChI=1S/C30H28BrN7O2/c1-21-6-8-24(18-27(21)37-30-34-12-10-26(36-30)23-5-4-11-32-19-23)35-29(39)22-7-9-28(25(31)17-22)40-16-3-2-14-38-15-13-33-20-38/h4-13,15,17-20H,2-3,14,16H2,1H3,(H,35,39)(H,34,36,37)
Standard InChI Key: NPIPAPROUARCLP-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
26.1116 -25.2173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1104 -26.0369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8185 -26.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5281 -26.0364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5253 -25.2137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8167 -24.8085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8201 -27.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1107 -27.6687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1102 -28.4851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8183 -28.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5285 -28.4819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5255 -27.6668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2315 -24.8025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.9407 -25.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9404 -26.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6489 -26.4291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3560 -26.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3503 -25.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6413 -24.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6515 -27.2463 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6340 -23.9771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3606 -27.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3633 -28.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0669 -27.2416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6551 -28.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6574 -29.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3670 -30.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0757 -29.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0699 -28.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3708 -30.9201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0804 -31.3254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7862 -30.9136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4958 -31.3189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2016 -30.9070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9112 -31.3124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0036 -32.1222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8037 -32.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2091 -31.5788 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6594 -30.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7862 -30.0914 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
5 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
16 20 1 0
19 21 1 0
20 22 1 0
22 23 1 0
22 24 2 0
23 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 23 1 0
27 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 35 1 0
28 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 598.51Molecular Weight (Monoisotopic): 597.1488AlogP: 6.66#Rotatable Bonds: 11Polar Surface Area: 106.85Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.69CX Basic pKa: 6.54CX LogP: 5.68CX LogD: 5.64Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.16Np Likeness Score: -1.77
References 1. Sorrenti V, Pittalà V, Romeo G, Amata E, Dichiara M, Marrazzo A, Turnaturi R, Prezzavento O, Barbagallo I, Vanella L, Rescifina A, Floresta G, Tibullo D, Di Raimondo F, Intagliata S, Salerno L.. (2018) Targeting heme Oxygenase-1 with hybrid compounds to overcome Imatinib resistance in chronic myeloid leukemia cell lines., 158 [PMID:30261468 ] [10.1016/j.ejmech.2018.09.048 ]