The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 2-amino-6-bromo-4-(2-(4-chlorophenyl)-2-oxoethyl)-8-methoxy-4H-chromene-3-carboxylate ID: ALA4289734
PubChem CID: 145989515
Max Phase: Preclinical
Molecular Formula: C20H17BrClNO5
Molecular Weight: 466.71
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=C(N)Oc2c(OC)cc(Br)cc2C1CC(=O)c1ccc(Cl)cc1
Standard InChI: InChI=1S/C20H17BrClNO5/c1-26-16-8-11(21)7-14-13(9-15(24)10-3-5-12(22)6-4-10)17(20(25)27-2)19(23)28-18(14)16/h3-8,13H,9,23H2,1-2H3
Standard InChI Key: GAIJIIJTVYDRCS-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
3.9026 -6.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9015 -7.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6163 -7.4900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6145 -5.8370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3298 -6.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3332 -7.0747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0484 -7.4836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7649 -7.0687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7614 -6.2403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0416 -5.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4804 -7.4793 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0371 -5.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3204 -4.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3159 -3.7683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6082 -5.0096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0286 -3.3540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0245 -2.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3072 -2.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5927 -2.5412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6003 -3.3641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4752 -5.8232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1909 -6.2334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4726 -4.9982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9041 -5.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6168 -8.3150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9026 -8.7280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1881 -5.8375 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
5.3015 -1.2954 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
8 11 1 0
10 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 14 1 0
21 22 1 0
21 23 2 0
9 21 1 0
22 24 1 0
3 25 1 0
25 26 1 0
1 27 1 0
18 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.71Molecular Weight (Monoisotopic): 464.9979AlogP: 4.20#Rotatable Bonds: 5Polar Surface Area: 87.85Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.15CX LogD: 4.15Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.52Np Likeness Score: -0.33
References 1. Pontes O, Costa M, Santos F, Sampaio-Marques B, Dias T, Ludovico P, Baltazar F, Proença F.. (2018) Exploitation of new chalcones and 4H-chromenes as agents for cancer treatment., 157 [PMID:30081238 ] [10.1016/j.ejmech.2018.07.058 ]