The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(2-(4-(ethylsulfonyl)phenyl)acetamido)-2-fluorophenyl)-N-(4-fluorophenyl)-2-methylpropanamide ID: ALA4290041
PubChem CID: 145987785
Max Phase: Preclinical
Molecular Formula: C26H26F2N2O4S
Molecular Weight: 500.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(C)(C)C(=O)Nc3ccc(F)cc3)c(F)c2)cc1
Standard InChI: InChI=1S/C26H26F2N2O4S/c1-4-35(33,34)21-12-5-17(6-13-21)15-24(31)29-20-11-14-22(23(28)16-20)26(2,3)25(32)30-19-9-7-18(27)8-10-19/h5-14,16H,4,15H2,1-3H3,(H,29,31)(H,30,32)
Standard InChI Key: JCIWZUTVGHDCLP-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
20.9663 -11.2591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9704 -12.0763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6761 -11.6641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6318 -11.3581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0445 -12.0680 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.4529 -11.3556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6789 -12.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6778 -13.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3858 -13.7133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0955 -13.3039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0926 -12.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3840 -12.0760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8038 -13.7114 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5109 -13.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2192 -13.7092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5096 -12.4845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9263 -13.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6334 -13.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3399 -13.2993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3391 -12.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6258 -12.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9221 -12.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7545 -12.4771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4610 -12.0664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2635 -12.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5557 -12.0767 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2637 -13.3024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8481 -12.4855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1408 -12.0753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4337 -12.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4334 -13.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1462 -13.7097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8504 -13.2993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7264 -13.7112 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.3778 -11.2550 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 5 1 0
5 23 1 0
23 24 1 0
7 2 1 0
2 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
12 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.57Molecular Weight (Monoisotopic): 500.1581AlogP: 4.86#Rotatable Bonds: 8Polar Surface Area: 92.34Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.31CX Basic pKa: ┄CX LogP: 4.85CX LogD: 4.85Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.46Np Likeness Score: -1.72
References 1. Sasaki Y, Odan M, Yamamoto S, Kida S, Ueyama A, Shimizu M, Haruna T, Watanabe A, Okuno T.. (2018) Discovery of a potent orally bioavailable retinoic acid receptor-related orphan receptor-gamma-t (RORγt) inhibitor, S18-000003., 28 (22): [PMID:30301676 ] [10.1016/j.bmcl.2018.09.032 ]