The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Hexanamido-9-acetamido-2,6-anhydro-3,5-dideoxy-Dglycero-D-galactonon-2-enonic Acid ID: ALA4290253
PubChem CID: 145989099
Max Phase: Preclinical
Molecular Formula: C17H28N2O8
Molecular Weight: 388.42
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CNC(C)=O)OC(C(=O)O)=C[C@@H]1O
Standard InChI: InChI=1S/C17H28N2O8/c1-3-4-5-6-13(23)19-14-10(21)7-12(17(25)26)27-16(14)15(24)11(22)8-18-9(2)20/h7,10-11,14-16,21-22,24H,3-6,8H2,1-2H3,(H,18,20)(H,19,23)(H,25,26)/t10-,11+,14+,15+,16+/m0/s1
Standard InChI Key: NLZZGCLVJKTGEH-IQVWLFHZSA-N
Molfile:
RDKit 2D
28 28 0 0 0 0 0 0 0 0999 V2000
18.6518 -16.5467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3464 -16.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3189 -15.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6036 -14.9173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9089 -15.3476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9295 -16.1645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0136 -14.8734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7336 -15.2599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9882 -14.0567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1900 -14.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8863 -14.5352 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.1670 -14.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4941 -15.3874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4481 -13.7536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8630 -13.7139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4252 -12.9368 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2348 -16.5949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2601 -17.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5655 -17.8420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9802 -17.7981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6795 -17.3634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8454 -17.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1507 -17.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4307 -17.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7063 -12.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0103 -12.9765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6833 -11.7314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7360 -17.9299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
3 7 1 0
7 8 1 0
7 9 2 0
5 10 1 0
5 11 1 1
10 12 1 0
10 13 1 6
12 14 1 0
12 15 1 1
14 16 1 0
6 17 1 1
17 18 1 0
18 19 1 0
18 20 2 0
1 21 1 6
19 22 1 0
22 23 1 0
23 24 1 0
16 25 1 0
25 26 1 0
25 27 2 0
24 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 388.42Molecular Weight (Monoisotopic): 388.1846AlogP: -1.36#Rotatable Bonds: 10Polar Surface Area: 165.42Molecular Species: ACIDHBA: 7HBD: 6#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.20CX Basic pKa: ┄CX LogP: -1.94CX LogD: -5.39Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.25Np Likeness Score: 0.86
References 1. Guo T, Héon-Roberts R, Zou C, Zheng R, Pshezhetsky AV, Cairo CW.. (2018) Selective Inhibitors of Human Neuraminidase 1 (NEU1)., 61 (24): [PMID:30457869 ] [10.1021/acs.jmedchem.8b01411 ] 2. (2018) Methods of preventing or treating atherosclerosis with inhibitors of specific isoenzymes of human neuraminidase,