The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Cyano-1H-imidazole-2-carboxylic acid {2-(4,4-dimethyl-cyclohex-1-enyl)-4-[1-(2-hydroxy-ethylamino)-1-methyl-ethyl]-pheny}-amide hydrochloride ID: ALA4290291
PubChem CID: 86615982
Max Phase: Preclinical
Molecular Formula: C24H32ClN5O2
Molecular Weight: 421.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC=C(c2cc(C(C)(C)NCCO)ccc2NC(=O)c2nc(C#N)c[nH]2)CC1.Cl
Standard InChI: InChI=1S/C24H31N5O2.ClH/c1-23(2)9-7-16(8-10-23)19-13-17(24(3,4)27-11-12-30)5-6-20(19)29-22(31)21-26-15-18(14-25)28-21;/h5-7,13,15,27,30H,8-12H2,1-4H3,(H,26,28)(H,29,31);1H
Standard InChI Key: NGHAAKJLWCSDBM-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
11.2664 -16.2372 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -16.1955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0833 -15.4831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6704 -16.1929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0915 -10.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5082 -11.3623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9205 -10.6432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8026 -14.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8015 -15.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5162 -15.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2327 -15.0724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2299 -14.2419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5145 -13.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5104 -13.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2254 -12.6001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2250 -11.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7961 -11.7779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7949 -12.6055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9427 -13.8267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6588 -14.2365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3716 -13.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6619 -15.0615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1258 -14.1528 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4541 -12.9994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2604 -12.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6716 -13.5374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5892 -12.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9233 -11.3175 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3707 -15.0671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9481 -15.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6609 -15.4782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2298 -15.4639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 3 1 0
6 5 1 0
7 6 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
14 15 1 0
14 18 2 0
15 16 1 0
16 6 1 0
6 17 1 0
17 18 1 0
13 14 1 0
12 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 26 1 0
25 24 1 0
24 21 2 0
9 3 1 0
25 26 2 0
27 28 3 0
25 27 1 0
3 29 1 0
29 31 1 0
30 31 1 0
30 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 421.55Molecular Weight (Monoisotopic): 421.2478AlogP: 3.94#Rotatable Bonds: 7Polar Surface Area: 113.83Molecular Species: BASEHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.42CX Basic pKa: 8.93CX LogP: 1.99CX LogD: 1.78Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -0.30
References 1. (2016) Inhibitors of c-fms kinase,