(E)-N-(3,4-dimethoxyphenyl)-2-(4-(3-(4-ethoxyphenyl)acryloyl)phenoxy)acetamide

ID: ALA4290695

PubChem CID: 145989554

Max Phase: Preclinical

Molecular Formula: C27H27NO6

Molecular Weight: 461.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOc1ccc(/C=C/C(=O)c2ccc(OCC(=O)Nc3ccc(OC)c(OC)c3)cc2)cc1

Standard InChI:  InChI=1S/C27H27NO6/c1-4-33-22-11-5-19(6-12-22)7-15-24(29)20-8-13-23(14-9-20)34-18-27(30)28-21-10-16-25(31-2)26(17-21)32-3/h5-17H,4,18H2,1-3H3,(H,28,30)/b15-7+

Standard InChI Key:  FBXIADDKORFFFG-VIZOYTHASA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   18.3455  -24.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3497  -25.1183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0554  -23.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7612  -24.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7612  -25.1183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0554  -25.5269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4691  -25.5265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1766  -25.1175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8845  -25.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1761  -24.3003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5920  -25.1166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3000  -25.5248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2959  -26.3410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0031  -26.7491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7115  -26.3401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7084  -25.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0007  -25.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4200  -26.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4216  -27.5645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1269  -26.3373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8354  -26.7446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5423  -26.3346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2472  -26.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9537  -26.3352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9525  -25.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2390  -25.1101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5355  -25.5217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6589  -25.1062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.3679  -25.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6371  -23.8856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6427  -25.5283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6356  -23.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9342  -25.1210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0743  -25.1016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  3  2  0
  5  4  1  0
  6  2  1  0
  6  5  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 28 29  1  0
  1 30  1  0
  2 31  1  0
 30 32  1  0
 31 33  1  0
 29 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4290695

    ---

Associated Targets(Human)

IMPDH2 Tclin Inosine-5'-monophosphate dehydrogenase 2 (1326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.51Molecular Weight (Monoisotopic): 461.1838AlogP: 5.02#Rotatable Bonds: 11
Polar Surface Area: 83.09Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.61CX Basic pKa: CX LogP: 4.53CX LogD: 4.53
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -0.90

References

1. Shah CP, Kharkar PS..  (2018)  Discovery of novel human inosine 5'-monophosphate dehydrogenase 2 (hIMPDH2) inhibitors as potential anticancer agents.,  158  [PMID:30223117] [10.1016/j.ejmech.2018.09.016]

Source