3-(2,3-dihydroxypropyl)-6,7-diphenyl-3H-pyrrolo[2,3-d]pyrimidin-4(7H)-one

ID: ALA4290762

PubChem CID: 145988476

Max Phase: Preclinical

Molecular Formula: C21H19N3O3

Molecular Weight: 361.40

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1c2cc(-c3ccccc3)n(-c3ccccc3)c2ncn1CC(O)CO

Standard InChI:  InChI=1S/C21H19N3O3/c25-13-17(26)12-23-14-22-20-18(21(23)27)11-19(15-7-3-1-4-8-15)24(20)16-9-5-2-6-10-16/h1-11,14,17,25-26H,12-13H2

Standard InChI Key:  HLOANKFJZOKFDO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   30.9250   -5.0792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6347   -4.6697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6319   -3.8471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9233   -3.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2170   -4.6702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2137   -3.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4361   -3.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9588   -4.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4415   -4.9256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.1462   -4.2710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7353   -3.5634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9189   -3.5663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5123   -4.2763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9282   -4.9846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7433   -4.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1918   -5.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3918   -5.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1423   -6.6517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6918   -7.2577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4940   -7.0811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7398   -6.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9206   -2.6246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3380   -3.4358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0473   -3.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7535   -3.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0504   -4.6589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4627   -3.8364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  9 16  1  0
  4 22  2  0
  3 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 25 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4290762

    ---

Associated Targets(non-human)

unidentified influenza virus (265 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 361.40Molecular Weight (Monoisotopic): 361.1426AlogP: 2.21#Rotatable Bonds: 5
Polar Surface Area: 80.28Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.97CX Basic pKa: 1.55CX LogP: 2.25CX LogD: 2.25
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.57Np Likeness Score: -0.81

References

1. Pathania S, Rawal RK..  (2018)  Pyrrolopyrimidines: An update on recent advancements in their medicinal attributes.,  157  [PMID:30114661] [10.1016/j.ejmech.2018.08.023]

Source