3-(2-(2-hydroxyethoxy)ethyl)-6,7-diphenyl-3H-pyrrolo[2,3-d]pyrimidin-4(7H)-one

ID: ALA4291177

PubChem CID: 145986660

Max Phase: Preclinical

Molecular Formula: C22H21N3O3

Molecular Weight: 375.43

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1c2cc(-c3ccccc3)n(-c3ccccc3)c2ncn1CCOCCO

Standard InChI:  InChI=1S/C22H21N3O3/c26-12-14-28-13-11-24-16-23-21-19(22(24)27)15-20(17-7-3-1-4-8-17)25(21)18-9-5-2-6-10-18/h1-10,15-16,26H,11-14H2

Standard InChI Key:  XCGPRORKPGDSQX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   17.0947   -5.4424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8044   -5.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8015   -4.2103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0929   -3.8050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3867   -5.0334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3834   -4.2169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6058   -3.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1285   -4.6302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6111   -5.2888    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3158   -4.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9049   -3.9266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0885   -3.9295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6820   -4.6394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0979   -5.3478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9129   -5.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3614   -6.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5614   -6.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3120   -7.0149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8615   -7.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6637   -7.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9094   -6.6671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0903   -2.9878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5077   -3.7990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2169   -4.2049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9231   -3.7937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6324   -4.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3385   -3.7883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0478   -4.1943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  9 16  1  0
  4 22  2  0
  3 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4291177

    ---

Associated Targets(non-human)

unidentified influenza virus (265 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 375.43Molecular Weight (Monoisotopic): 375.1583AlogP: 2.86#Rotatable Bonds: 7
Polar Surface Area: 69.28Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.47CX LogP: 2.83CX LogD: 2.83
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.50Np Likeness Score: -1.05

References

1. Pathania S, Rawal RK..  (2018)  Pyrrolopyrimidines: An update on recent advancements in their medicinal attributes.,  157  [PMID:30114661] [10.1016/j.ejmech.2018.08.023]

Source