The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2alpha,3beta,23-Trihydroxy-N-(phenylmethyl)-urs-12-en-28-amide ID: ALA4291236
PubChem CID: 145988917
Max Phase: Preclinical
Molecular Formula: C37H55NO4
Molecular Weight: 577.85
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H]1[C@H](C)CC[C@]2(C(=O)NCc3ccccc3)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)[C@@](C)(CO)[C@@H]5CC[C@]43C)[C@H]12
Standard InChI: InChI=1S/C37H55NO4/c1-23-14-17-37(32(42)38-21-25-10-8-7-9-11-25)19-18-35(5)26(30(37)24(23)2)12-13-29-33(3)20-27(40)31(41)34(4,22-39)28(33)15-16-36(29,35)6/h7-12,23-24,27-31,39-41H,13-22H2,1-6H3,(H,38,42)/t23-,24+,27-,28-,29-,30+,31+,33+,34+,35-,36-,37+/m1/s1
Standard InChI Key: VJRRYSXHNNFXDZ-ZDCBVIPJSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
33.1912 -12.8522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0491 -14.0656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1747 -13.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4607 -14.0780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9052 -12.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6109 -12.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3516 -15.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7549 -13.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0491 -14.8828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4813 -12.4395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3516 -13.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6459 -14.8828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3084 -13.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9176 -11.6264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6459 -14.0656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8722 -14.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4607 -14.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7673 -12.8398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5903 -13.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7549 -15.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3332 -12.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3084 -14.1027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6398 -11.2384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3456 -11.6635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7602 -15.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0491 -13.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9401 -15.2914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.1664 -14.4948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0225 -12.8852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4565 -13.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9319 -13.6570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3434 -16.7029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2159 -11.2054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6605 -10.4254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0450 -15.6959 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
31.7549 -14.4742 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
33.8969 -13.2732 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
36.7286 -13.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4379 -12.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1425 -13.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8513 -12.8988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8549 -12.0807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1438 -11.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4379 -12.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7697 -15.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 8 1 0
3 1 1 0
4 3 1 0
5 1 1 0
6 5 1 0
7 9 1 0
8 18 1 0
9 2 1 0
10 1 2 0
11 2 1 0
12 15 1 0
6 13 1 1
14 5 1 0
15 11 1 0
16 3 1 0
17 4 1 0
18 10 1 0
19 6 1 0
20 17 1 0
21 6 1 0
22 13 2 0
23 14 1 0
24 23 1 0
25 7 1 0
2 26 1 1
12 27 1 1
3 28 1 6
29 13 1 0
4 30 1 1
15 31 1 6
32 25 1 0
14 33 1 1
23 34 1 6
9 35 1 6
8 36 1 6
5 37 1 1
4 8 1 0
16 19 1 0
21 24 1 0
9 20 1 0
7 12 1 0
29 38 1 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 39 1 0
7 45 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 577.85Molecular Weight (Monoisotopic): 577.4131AlogP: 6.26#Rotatable Bonds: 4Polar Surface Area: 89.79Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.55CX Basic pKa: 0.67CX LogP: 5.37CX LogD: 5.37Aromatic Rings: 1Heavy Atoms: 42QED Weighted: 0.32Np Likeness Score: 2.25
References 1. Kahnt M, Wiemann J, Fischer L, Sommerwerk S, Csuk R.. (2018) Transformation of asiatic acid into a mitocanic, bimodal-acting rhodamine B conjugate of nanomolar cytotoxicity., 159 [PMID:30278332 ] [10.1016/j.ejmech.2018.09.066 ]