The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(((4-(5-Chloro-2-(((1R,4r)-4-(((R)-1-methoxypropan-2-yl)amino)cyclohexyl)amino)pyridin-4-yl)thiazol-2-yl)amino)methyl)tetrahydro-2H-pyran-4-carbonitrile ID: ALA4291684
PubChem CID: 141725841
Max Phase: Preclinical
Molecular Formula: C25H35ClN6O2S
Molecular Weight: 519.12
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC[C@@H](C)N[C@H]1CC[C@H](Nc2cc(-c3csc(NCC4(C#N)CCOCC4)n3)c(Cl)cn2)CC1
Standard InChI: InChI=1S/C25H35ClN6O2S/c1-17(13-33-2)30-18-3-5-19(6-4-18)31-23-11-20(21(26)12-28-23)22-14-35-24(32-22)29-16-25(15-27)7-9-34-10-8-25/h11-12,14,17-19,30H,3-10,13,16H2,1-2H3,(H,28,31)(H,29,32)/t17-,18-,19-/m1/s1
Standard InChI Key: PGVNLOUNSPQGJP-GUDVDZBRSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
37.6189 -19.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6189 -20.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9057 -20.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1925 -20.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1925 -19.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9057 -18.9296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3280 -18.9296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4875 -20.5722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0611 -20.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7743 -20.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3520 -20.1636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6388 -20.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0412 -19.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7544 -18.9296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4635 -19.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4635 -20.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7544 -20.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0412 -20.1636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.0674 -17.9443 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
42.4760 -18.6534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9240 -19.2640 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.1726 -18.9296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2607 -18.1109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1726 -20.5722 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
43.2946 -18.6509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.7095 -19.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5308 -19.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9370 -20.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7547 -20.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1691 -19.3586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.7555 -18.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9316 -18.6451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1118 -20.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6970 -20.7741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7743 -19.3465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
1 7 1 1
4 8 1 6
9 10 1 0
11 12 1 0
9 11 1 0
8 10 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
19 23 1 0
15 22 1 0
16 24 1 0
7 13 1 0
20 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
27 33 1 0
33 34 3 0
10 35 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.12Molecular Weight (Monoisotopic): 518.2231AlogP: 4.94#Rotatable Bonds: 10Polar Surface Area: 104.12Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.18CX LogP: 3.43CX LogD: 0.78Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -1.28
References 1. Wang B, Wu J, Wu Y, Chen C, Zou F, Wang A, Wu H, Hu Z, Jiang Z, Liu Q, Wang W, Zhang Y, Liu F, Zhao M, Hu J, Huang T, Ge J, Wang L, Ren T, Wang Y, Liu J, Liu Q.. (2018) Discovery of 4-(((4-(5-chloro-2-(((1s,4s)-4-((2-methoxyethyl)amino)cyclohexyl)amino)pyridin-4-yl)thiazol-2-yl)amino)methyl)tetrahydro-2H-pyran-4-carbonitrile (JSH-150) as a novel highly selective and potent CDK9 kinase inhibitor., 158 [PMID:30253346 ] [10.1016/j.ejmech.2018.09.025 ]