The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Heptyl 3-(((((2S,5R)-2-Carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl)oxy)sulfonyl)oxy)-2,2-dimethylpropanoate ID: ALA4291810
PubChem CID: 135339044
Max Phase: Preclinical
Molecular Formula: C19H33N3O8S
Molecular Weight: 463.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCOC(=O)C(C)(C)COS(=O)(=O)ON1C(=O)N2C[C@H]1CC[C@H]2C(N)=O
Standard InChI: InChI=1S/C19H33N3O8S/c1-4-5-6-7-8-11-28-17(24)19(2,3)13-29-31(26,27)30-22-14-9-10-15(16(20)23)21(12-14)18(22)25/h14-15H,4-13H2,1-3H3,(H2,20,23)/t14-,15+/m1/s1
Standard InChI Key: DZJAYPFVMXXJBZ-CABCVRRESA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
9.2886 -13.3616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0811 -12.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5199 -13.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9827 -10.8985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1882 -11.6699 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.7517 -11.1058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4966 -9.7162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4966 -10.5128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1814 -10.9069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8703 -10.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8703 -9.7162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1814 -9.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4945 -11.3093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8634 -11.3093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9263 -11.8690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8050 -9.3211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8014 -8.5245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1184 -9.7204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4254 -11.8751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7515 -12.2372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5231 -12.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8546 -12.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4322 -11.0746 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.4202 -12.9593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0669 -11.6196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2098 -12.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7870 -13.3271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5766 -13.1165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1538 -13.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9434 -13.4843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5206 -14.0628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3102 -13.8521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 2 0
6 5 2 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
8 13 1 0
10 14 1 0
13 14 1 0
13 15 2 0
16 17 2 0
16 18 1 0
7 16 1 6
14 19 1 0
19 5 1 0
5 20 1 0
20 21 1 0
21 2 1 0
2 22 1 0
10 23 1 6
22 24 1 0
22 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.55Molecular Weight (Monoisotopic): 463.1988AlogP: 1.47#Rotatable Bonds: 13Polar Surface Area: 145.54Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.23CX LogD: 2.23Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.32Np Likeness Score: -0.11
References 1. Gordon EM, Duncton MAJ, Gallop MA.. (2018) Orally Absorbed Derivatives of the β-Lactamase Inhibitor Avibactam. Design of Novel Prodrugs of Sulfate Containing Drugs., 61 (22): [PMID:30296086 ] [10.1021/acs.jmedchem.8b01389 ]