Heptyl 3-(((((2S,5R)-2-Carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl)oxy)sulfonyl)oxy)-2,2-dimethylpropanoate

ID: ALA4291810

PubChem CID: 135339044

Max Phase: Preclinical

Molecular Formula: C19H33N3O8S

Molecular Weight: 463.55

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCCCCCCOC(=O)C(C)(C)COS(=O)(=O)ON1C(=O)N2C[C@H]1CC[C@H]2C(N)=O

Standard InChI:  InChI=1S/C19H33N3O8S/c1-4-5-6-7-8-11-28-17(24)19(2,3)13-29-31(26,27)30-22-14-9-10-15(16(20)23)21(12-14)18(22)25/h14-15H,4-13H2,1-3H3,(H2,20,23)/t14-,15+/m1/s1

Standard InChI Key:  DZJAYPFVMXXJBZ-CABCVRRESA-N

Molfile:  

     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
    9.2886  -13.3616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0811  -12.5964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5199  -13.1561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9827  -10.8985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1882  -11.6699    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.7517  -11.1058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4966   -9.7162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4966  -10.5128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1814  -10.9069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8703  -10.5128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8703   -9.7162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1814   -9.3138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4945  -11.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8634  -11.3093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9263  -11.8690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8050   -9.3211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8014   -8.5245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1184   -9.7204    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4254  -11.8751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7515  -12.2372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5231  -12.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8546  -12.3924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4322  -11.0746    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.4202  -12.9593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0669  -11.6196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2098  -12.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7870  -13.3271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5766  -13.1165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1538  -13.6949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9434  -13.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5206  -14.0628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3102  -13.8521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  2  0
  6  5  2  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  8 13  1  0
 10 14  1  0
 13 14  1  0
 13 15  2  0
 16 17  2  0
 16 18  1  0
  7 16  1  6
 14 19  1  0
 19  5  1  0
  5 20  1  0
 20 21  1  0
 21  2  1  0
  2 22  1  0
 10 23  1  6
 22 24  1  0
 22 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4291810

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 463.55

Molecular Weight (Monoisotopic): 463.1988

AlogP: 1.47

#Rotatable Bonds: 13

Polar Surface Area: 145.54

Molecular Species: NEUTRAL

HBA: 8

HBD: 1

#RO5 Violations: ┄

HBA (Lipinski): 11

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 2.23

CX LogD: 2.23

Aromatic Rings: ┄

Heavy Atoms: 31

QED Weighted: 0.32

Np Likeness Score: -0.11

References

1. Gordon EM, Duncton MAJ, Gallop MA..  (2018)  Orally Absorbed Derivatives of the β-Lactamase Inhibitor Avibactam. Design of Novel Prodrugs of Sulfate Containing Drugs.,  61  (22): [PMID:30296086] [10.1021/acs.jmedchem.8b01389]

Source

Source(1):

• Scientific Literature