4-((S)-3-((R)-2-(6-benzylpyrazin-2-yl)pyrrolidin-1-yl)-2-((S)-2-(methylamino)propanamido)-3-oxopropyl)benzylphosphonic acid

ID: ALA4291873

PubChem CID: 142585375

Max Phase: Preclinical

Molecular Formula: C29H36N5O5P

Molecular Weight: 565.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN[C@@H](C)C(=O)N[C@@H](Cc1ccc(CP(=O)(O)O)cc1)C(=O)N1CCC[C@@H]1c1cncc(Cc2ccccc2)n1

Standard InChI:  InChI=1S/C29H36N5O5P/c1-20(30-2)28(35)33-25(16-22-10-12-23(13-11-22)19-40(37,38)39)29(36)34-14-6-9-27(34)26-18-31-17-24(32-26)15-21-7-4-3-5-8-21/h3-5,7-8,10-13,17-18,20,25,27,30H,6,9,14-16,19H2,1-2H3,(H,33,35)(H2,37,38,39)/t20-,25-,27+/m0/s1

Standard InChI Key:  WUBYWMCSLYLAKN-QOAWAWRESA-N

Molfile:  

     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
    5.4974   -1.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -2.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5075   -2.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0816   -1.7784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8585   -0.9866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0672   -0.7859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5861   -3.6145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1639   -4.1923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8920   -3.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7642   -3.0142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9571   -2.8865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0459   -4.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7536   -3.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3382   -3.6155    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6305   -4.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0459   -4.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4613   -4.0240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7536   -2.7983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1690   -3.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8767   -4.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1690   -2.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8767   -4.8412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0360   -4.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4287   -0.4012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2208   -0.6023    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    8.7910   -0.0170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4426   -1.3889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0027    0.1940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2728   -5.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1447   -6.0968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7802   -6.6119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5461   -6.3151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6705   -5.5096    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1830   -6.8272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9448   -6.5317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5783   -7.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3396   -6.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4651   -5.9426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8233   -5.4300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0645   -5.7277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 12 16  1  6
 13 17  1  0
 13 18  2  0
 17 19  1  0
 19 20  1  0
 19 21  1  1
 21  2  1  0
 20  7  1  0
 20 22  2  0
  8 23  1  6
  5 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 25 28  1  0
 23 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 23  1  0
 32 34  1  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4291873

    ---

Associated Targets(Human)

BIRC3 Tchem Baculoviral IAP repeat-containing protein 3 (320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BIRC2 Tchem Baculoviral IAP repeat-containing protein 2 (984 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
XIAP Tchem Inhibitor of apoptosis protein 3 (3673 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 565.61Molecular Weight (Monoisotopic): 565.2454AlogP: 2.74#Rotatable Bonds: 11
Polar Surface Area: 144.75Molecular Species: ZWITTERIONHBA: 6HBD: 4
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 1.73CX Basic pKa: 8.69CX LogP: -0.09CX LogD: -0.17
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.26Np Likeness Score: -0.23

References

1. Baggio C, Gambini L, Udompholkul P, Salem AF, Aronson A, Dona A, Troadec E, Pichiorri F, Pellecchia M..  (2018)  Design of Potent pan-IAP and Lys-Covalent XIAP Selective Inhibitors Using a Thermodynamics Driven Approach.,  61  (14): [PMID:29940121] [10.1021/acs.jmedchem.8b00810]

Source