The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(1,3-dimethyl-2,6-dioxo-8-propoxy-2,3,6,7-tetrahydro-1H-purin-7-yl)-N-[4-(propan-2-yl)phenyl]butanamide ID: ALA4291934
PubChem CID: 145986925
Max Phase: Preclinical
Molecular Formula: C23H31N5O4
Molecular Weight: 441.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCOc1nc2c(c(=O)n(C)c(=O)n2C)n1CCCC(=O)Nc1ccc(C(C)C)cc1
Standard InChI: InChI=1S/C23H31N5O4/c1-6-14-32-22-25-20-19(21(30)27(5)23(31)26(20)4)28(22)13-7-8-18(29)24-17-11-9-16(10-12-17)15(2)3/h9-12,15H,6-8,13-14H2,1-5H3,(H,24,29)
Standard InChI Key: UNHDMYZCRLZPEZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
18.1228 -21.8814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6110 -21.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1359 -20.5579 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3481 -21.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3597 -20.8047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6621 -20.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9484 -20.7845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9367 -21.6012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6388 -22.0220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6282 -22.8391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2472 -20.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6749 -19.5714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2228 -21.9989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4282 -21.2349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8290 -21.9470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3948 -19.7828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1955 -19.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4544 -18.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2551 -18.6810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5139 -17.9060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7969 -19.2928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3146 -17.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8514 -18.3552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6514 -18.1924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9110 -17.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3644 -16.8034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5664 -16.9694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6461 -21.9560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7115 -17.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2541 -17.8632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9693 -16.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0469 -22.6681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 1 1 0
1 2 2 0
2 3 1 0
3 5 1 0
4 5 2 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
7 11 1 0
6 12 2 0
8 13 2 0
2 14 1 0
14 15 1 0
3 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
15 28 1 0
25 29 1 0
29 30 1 0
29 31 1 0
28 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.53Molecular Weight (Monoisotopic): 441.2376AlogP: 2.76#Rotatable Bonds: 9Polar Surface Area: 100.15Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.54CX LogD: 3.54Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.55Np Likeness Score: -1.42
References 1. Chłoń-Rzepa G, Ślusarczyk M, Jankowska A, Gawalska A, Bucki A, Kołaczkowski M, Świerczek A, Pociecha K, Wyska E, Zygmunt M, Kazek G, Sałat K, Pawłowski M.. (2018) Novel amide derivatives of 1,3-dimethyl-2,6-dioxopurin-7-yl-alkylcarboxylic acids as multifunctional TRPA1 antagonists and PDE4/7 inhibitors: A new approach for the treatment of pain., 158 [PMID:30245393 ] [10.1016/j.ejmech.2018.09.021 ] 2. Dąbrowska M, Starek M, Chłoń-Rzepa G, Zagórska A, Komsta Ł, Jankowska A, Ślusarczyk M, Pawłowski M.. (2021) Estimation of the lipophilicity of purine-2,6-dione-based TRPA1 antagonists and PDE4/7 inhibitors with analgesic activity., 49 [PMID:34391892 ] [10.1016/j.bmcl.2021.128318 ]