The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-methoxypyridin-3-yl)-2-oxo-3-(4-(pyridin-3-yl)piperazin-1-yl)-1-(quinolin-8-ylsulfonyl)indoline-5-carbonitrile ID: ALA4292247
PubChem CID: 145988954
Max Phase: Preclinical
Molecular Formula: C33H27N7O4S
Molecular Weight: 617.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ncccc1C1(N2CCN(c3cccnc3)CC2)C(=O)N(S(=O)(=O)c2cccc3cccnc23)c2ccc(C#N)cc21
Standard InChI: InChI=1S/C33H27N7O4S/c1-44-31-26(9-5-15-37-31)33(39-18-16-38(17-19-39)25-8-4-13-35-22-25)27-20-23(21-34)11-12-28(27)40(32(33)41)45(42,43)29-10-2-6-24-7-3-14-36-30(24)29/h2-15,20,22H,16-19H2,1H3
Standard InChI Key: IQJADMSRZMVXAU-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 51 0 0 0 0 0 0 0 0999 V2000
5.4146 -23.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4146 -23.9717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1199 -24.3762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8252 -23.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8252 -23.1545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1199 -22.7418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5193 -23.5789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5234 -24.3960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4933 -26.0841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7876 -26.4968 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.4979 -26.9016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3346 -24.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3334 -25.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0415 -25.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0397 -24.2513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6268 -24.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7483 -24.6566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7531 -25.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5332 -25.7236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0105 -25.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8277 -25.0537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2469 -27.1098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1621 -28.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9671 -28.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5066 -27.8810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2273 -23.1685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2235 -22.3521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5132 -21.9463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8052 -22.3628 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8125 -23.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1082 -23.5923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3971 -23.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5341 -22.7480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2368 -23.1618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9452 -22.7560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9480 -21.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2365 -21.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5310 -21.9356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9052 -27.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4477 -26.9433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1917 -26.1714 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3936 -26.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8520 -26.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1109 -27.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9190 -23.8433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
8 7 1 0
10 9 2 0
11 10 2 0
12 13 2 0
13 14 1 0
14 18 2 0
17 15 2 0
15 12 1 0
12 16 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 8 1 0
8 17 1 0
20 21 2 0
19 10 1 0
10 22 1 0
22 40 2 0
39 23 2 0
23 24 1 0
24 25 2 0
25 22 1 0
7 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 7 1 0
30 31 1 0
31 32 1 0
8 2 1 0
5 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
39 40 1 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 39 1 0
16 45 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 617.69Molecular Weight (Monoisotopic): 617.1845AlogP: 3.71#Rotatable Bonds: 6Polar Surface Area: 132.62Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.58CX LogP: 3.72CX LogD: 3.71Aromatic Rings: 5Heavy Atoms: 45QED Weighted: 0.28Np Likeness Score: -1.18
References 1. Geneste H, Bhowmik S, van Gaalen MM, Hornberger W, Hutchins CW, Netz A, Oost T, Unger L.. (2018) Novel, potent, selective and brain penetrant vasopressin 1b receptor antagonists., 28 (19): [PMID:30098866 ] [10.1016/j.bmcl.2018.07.043 ]