2-(4-(ethylsulfonyl)phenyl)-N-(4-(2-methyl-1-oxo-1-(2-azaspiro[3.3]heptan-2-yl)propan-2-yl)phenyl)acetamide

ID: ALA4292660

PubChem CID: 145987881

Max Phase: Preclinical

Molecular Formula: C26H32N2O4S

Molecular Weight: 468.62

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(C)(C)C(=O)N3CC4(CCC4)C3)cc2)cc1

Standard InChI:  InChI=1S/C26H32N2O4S/c1-4-33(31,32)22-12-6-19(7-13-22)16-23(29)27-21-10-8-20(9-11-21)25(2,3)24(30)28-17-26(18-28)14-5-15-26/h6-13H,4-5,14-18H2,1-3H3,(H,27,29)

Standard InChI Key:  SLDVOINBPKMOPL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    2.6483   -7.5744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4336   -6.7820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6412   -6.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8558   -7.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7255   -7.4414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1382   -8.1513    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.5466   -7.4389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6514   -7.4496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0641   -8.1595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4725   -7.4472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7726   -8.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7714   -9.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4795   -9.7966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1891   -9.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1863   -8.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4777   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8975   -9.7946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6046   -9.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3129   -9.7924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6033   -8.5677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0200   -9.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7270   -9.7915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4336   -9.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4328   -8.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7194   -8.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0158   -8.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8482   -8.5603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5547   -8.1497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3572   -8.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6494   -8.1600    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3574   -9.3856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4376   -7.3666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8600   -8.3676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  1  1  0
  6  5  2  0
  7  6  2  0
  9  8  1  0
 10  9  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24  6  1  0
  6 27  1  0
 27 28  1  0
 11  9  1  0
  9 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
 32  1  1  0
  1 33  1  0
 33 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4292660

    ---

Associated Targets(Human)

RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.62Molecular Weight (Monoisotopic): 468.2083AlogP: 3.95#Rotatable Bonds: 7
Polar Surface Area: 83.55Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.96CX Basic pKa: CX LogP: 3.61CX LogD: 3.61
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.67Np Likeness Score: -1.42

References

1. Sasaki Y, Odan M, Yamamoto S, Kida S, Ueyama A, Shimizu M, Haruna T, Watanabe A, Okuno T..  (2018)  Discovery of a potent orally bioavailable retinoic acid receptor-related orphan receptor-gamma-t (RORγt) inhibitor, S18-000003.,  28  (22): [PMID:30301676] [10.1016/j.bmcl.2018.09.032]

Source