(E)-2-(3,4-dichlorobenzylidene)-N-(4-methoxyphenyl)hydrazinecarbothioamide

ID: ALA4293122

PubChem CID: 145989662

Max Phase: Preclinical

Molecular Formula: C15H13Cl2N3OS

Molecular Weight: 354.26

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(NC(=S)N/N=C/c2ccc(Cl)c(Cl)c2)cc1

Standard InChI:  InChI=1S/C15H13Cl2N3OS/c1-21-12-5-3-11(4-6-12)19-15(22)20-18-9-10-2-7-13(16)14(17)8-10/h2-9H,1H3,(H2,19,20,22)/b18-9+

Standard InChI Key:  FNZWRJDIYBKIPM-GIJQJNRQSA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   29.5270  -25.9277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5277  -26.7468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2363  -27.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9445  -26.7430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9398  -25.9209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2307  -25.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2264  -24.7003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9319  -24.2880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9276  -23.4708    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.6418  -24.6928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3473  -24.2805    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0572  -24.6853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7627  -24.2730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4705  -24.6821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1756  -24.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1717  -23.4524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4568  -23.0477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7547  -23.4617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2380  -27.9710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.5311  -28.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4496  -22.2306    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   35.8766  -23.0391    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  3 19  1  0
 19 20  1  0
 17 21  1  0
 16 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4293122

    ---

Associated Targets(non-human)

ptpA Probable low molecular weight protein-tyrosine-phosphatase (435 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 354.26Molecular Weight (Monoisotopic): 353.0156AlogP: 4.32#Rotatable Bonds: 4
Polar Surface Area: 45.65Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.41CX Basic pKa: 1.31CX LogP: 4.96CX LogD: 4.96
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.49Np Likeness Score: -2.10

References

1. Sens L, de Souza ACA, Pacheco LA, Menegatti ACO, Mori M, Mascarello A, Nunes RJ, Terenzi H..  (2018)  Synthetic thiosemicarbazones as a new class of Mycobacterium tuberculosis protein tyrosine phosphatase A inhibitors.,  26  (21): [PMID:30389409] [10.1016/j.bmc.2018.10.030]

Source