2-[(3R,7R,11R)-3-hydroxy-3,7,11,15-tetramethyl-hexadecyl]-6-methyl-3,5-bis(trideuteriomethyl)-1,4-benzoquinone

ID: ALA4293169

PubChem CID: 145987901

Max Phase: Preclinical

Molecular Formula: C29H50O3

Molecular Weight: 446.72

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  [2H]C([2H])([2H])C1=C(C)C(=O)C(CC[C@](C)(O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)=C(C([2H])([2H])[2H])C1=O

Standard InChI:  InChI=1S/C29H50O3/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8,32)19-17-26-25(7)27(30)23(5)24(6)28(26)31/h20-22,32H,9-19H2,1-8H3/t21-,22-,29-/m1/s1/i5D3,7D3

Standard InChI Key:  LTVDFSLWFKLJDQ-BCHQTGRQSA-N

Molfile:  

     RDKit          2D

 38 38  0  0  0  0  0  0  0  0999 V2000
   19.4897  -13.5925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8292  -14.3925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1923  -14.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1176  -14.8029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4085  -14.3884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1724  -16.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5856  -13.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4064  -13.6712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5342  -14.8071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1724  -16.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8762  -14.7904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1724  -14.3737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9940  -14.3820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5818  -16.0124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5836  -14.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0666  -14.4051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4873  -14.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4603  -14.7904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9466  -14.8113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7529  -14.3800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4603  -15.6072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6541  -14.4009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3592  -14.8155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8316  -13.5757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2416  -14.3968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7011  -14.7988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6565  -13.5841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8762  -15.6072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2886  -14.7946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7799  -14.8197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1745  -13.5565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8832  -13.1498    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4678  -13.1462    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1678  -12.7366    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7550  -16.0199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0450  -15.6154    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7598  -16.8370    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0423  -16.4222    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
 19 22  1  0
 28 14  2  0
 23 16  1  0
 11 15  1  0
 15 29  1  0
 22 27  1  6
 21 10  2  0
 11 12  2  0
 16 30  1  0
 13 26  1  0
 18 20  2  0
 26  5  1  0
  2 24  1  6
 10 28  1  0
 28 11  1  0
 17  3  1  0
 30 17  1  0
 25 19  1  0
  8 13  1  0
 17  1  1  0
 22 23  1  0
  2  9  1  0
 18 12  1  0
  4  2  1  0
  5  4  1  0
 13  7  1  1
 29 13  1  0
 10  6  1  0
 18 21  1  0
  9 25  1  0
 12 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
 21 35  1  0
 35 36  1  0
 35 37  1  0
 35 38  1  0
M  ISO  6  32   2  33   2  34   2  36   2  37   2  38   2
M  END

Associated Targets(Human)

CYP4F2 Tchem Cytochrome P450 4F2 (83 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.72Molecular Weight (Monoisotopic): 446.3760AlogP: 7.76#Rotatable Bonds: 15
Polar Surface Area: 54.37Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 9.03CX LogD: 9.03
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: 1.11

References

1. Taylor L, Krueger N, Malysheva O, Atkinson J, Parker RS..  (2018)  ω-Hydroxylation of α-tocopheryl quinone reveals a dual function for cytochrome P450-4F2 in vitamin E metabolism.,  26  (20): [PMID:30316641] [10.1016/j.bmc.2018.10.002]

Source