(1S,2S,3S,4S)-3-((5-ethynylnaphthalen-1-yloxy)carbonyl)-2,4-diphenylcyclobutanecarboxylic acid

ID: ALA4293382

PubChem CID: 130428271

Max Phase: Preclinical

Molecular Formula: C30H22O4

Molecular Weight: 446.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#Cc1cccc2c(OC(=O)[C@H]3[C@@H](c4ccccc4)[C@H](C(=O)O)[C@@H]3c3ccccc3)cccc12

Standard InChI:  InChI=1S/C30H22O4/c1-2-19-15-9-17-23-22(19)16-10-18-24(23)34-30(33)28-25(20-11-5-3-6-12-20)27(29(31)32)26(28)21-13-7-4-8-14-21/h1,3-18,25-28H,(H,31,32)/t25-,26-,27-,28-/m0/s1

Standard InChI Key:  FUPGSWJNOVXUBI-LJWNLINESA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   15.0231   -3.1408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0231   -3.9580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8403   -3.9580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8403   -3.1408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4452   -2.5629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6586   -1.7772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0815   -1.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2912   -1.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0811   -2.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6597   -2.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4452   -4.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6559   -4.3243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6567   -5.3252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4181   -2.5629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2075   -2.7745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2066   -1.7736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4181   -4.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2037   -5.3255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7807   -5.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5710   -5.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7811   -4.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2025   -4.3235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0789   -5.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9214   -7.0534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7111   -7.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2934   -6.6899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7138   -6.2626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2907   -5.6933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0856   -4.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3041   -4.6972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7278   -5.2714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9359   -6.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3568   -6.6280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7777   -7.2046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  1  1  0
  1  5  1  1
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  2 11  1  1
 11 12  2  0
 11 13  1  0
  4 14  1  6
 14 15  1  0
 14 16  2  0
  3 17  1  6
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 13 23  1  0
 23 28  1  0
 23 26  2  0
 27 24  1  0
 24 25  2  0
 25 26  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 27  2  0
 32 33  1  0
 33 34  3  0
M  END

Alternative Forms

  1. Parent:

    ALA4293382

    ---

Associated Targets(Human)

FABP3 Tchem Fatty acid binding protein muscle (214 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FABP5 Tchem Fatty acid binding protein epidermal (323 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FABP7 Tchem Fatty acid-binding protein, brain (49 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.50Molecular Weight (Monoisotopic): 446.1518AlogP: 5.62#Rotatable Bonds: 5
Polar Surface Area: 63.60Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.23CX Basic pKa: CX LogP: 6.01CX LogD: 2.99
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -0.05

References

1. Yan S, Elmes MW, Tong S, Hu K, Awwa M, Teng GYH, Jing Y, Freitag M, Gan Q, Clement T, Wei L, Sweeney JM, Joseph OM, Che J, Carbonetti GS, Wang L, Bogdan DM, Falcone J, Smietalo N, Zhou Y, Ralph B, Hsu HC, Li H, Rizzo RC, Deutsch DG, Kaczocha M, Ojima I..  (2018)  SAR studies on truxillic acid mono esters as a new class of antinociceptive agents targeting fatty acid binding proteins.,  154  [PMID:29803996] [10.1016/j.ejmech.2018.04.050]

Source