2-(4-(2-(4-(ethylsulfonyl)phenyl)acetamido)phenyl)-N,2-dimethyl-N-phenylpropanamide

ID: ALA4293415

PubChem CID: 145987907

Max Phase: Preclinical

Molecular Formula: C27H30N2O4S

Molecular Weight: 478.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(C)(C)C(=O)N(C)c3ccccc3)cc2)cc1

Standard InChI:  InChI=1S/C27H30N2O4S/c1-5-34(32,33)24-17-11-20(12-18-24)19-25(30)28-22-15-13-21(14-16-22)27(2,3)26(31)29(4)23-9-7-6-8-10-23/h6-18H,5,19H2,1-4H3,(H,28,30)

Standard InChI Key:  GSDTZGJDQDTFBK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    5.1921  -12.2166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1962  -13.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9018  -12.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8575  -12.3157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2703  -13.0255    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.6787  -12.3132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9046  -13.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9035  -14.2619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6115  -14.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3212  -14.2614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3184  -13.4387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6098  -13.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0296  -14.6689    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7366  -14.2592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4450  -14.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7353  -13.4420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1520  -14.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8591  -14.6658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5657  -14.2568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5648  -13.4387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8515  -13.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1478  -13.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9802  -13.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6868  -13.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4892  -13.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7814  -13.0343    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4894  -14.2599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0738  -13.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3665  -13.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6594  -13.4409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6592  -14.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3719  -14.6673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0761  -14.2568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7812  -12.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20  5  1  0
  5 23  1  0
 23 24  1  0
  7  2  1  0
  2 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 26 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4293415

    ---

Associated Targets(Human)

RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 478.61Molecular Weight (Monoisotopic): 478.1926AlogP: 4.60#Rotatable Bonds: 8
Polar Surface Area: 83.55Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.96CX Basic pKa: CX LogP: 4.43CX LogD: 4.43
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.51Np Likeness Score: -1.66

References

1. Sasaki Y, Odan M, Yamamoto S, Kida S, Ueyama A, Shimizu M, Haruna T, Watanabe A, Okuno T..  (2018)  Discovery of a potent orally bioavailable retinoic acid receptor-related orphan receptor-gamma-t (RORγt) inhibitor, S18-000003.,  28  (22): [PMID:30301676] [10.1016/j.bmcl.2018.09.032]

Source