The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(2-(4-(ethylsulfonyl)phenyl)acetamido)phenyl)-N,2-dimethyl-N-phenylpropanamide ID: ALA4293415
PubChem CID: 145987907
Max Phase: Preclinical
Molecular Formula: C27H30N2O4S
Molecular Weight: 478.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(C)(C)C(=O)N(C)c3ccccc3)cc2)cc1
Standard InChI: InChI=1S/C27H30N2O4S/c1-5-34(32,33)24-17-11-20(12-18-24)19-25(30)28-22-15-13-21(14-16-22)27(2,3)26(31)29(4)23-9-7-6-8-10-23/h6-18H,5,19H2,1-4H3,(H,28,30)
Standard InChI Key: GSDTZGJDQDTFBK-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
5.1921 -12.2166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1962 -13.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9018 -12.6216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8575 -12.3157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2703 -13.0255 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.6787 -12.3132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9046 -13.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9035 -14.2619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6115 -14.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3212 -14.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3184 -13.4387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6098 -13.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0296 -14.6689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7366 -14.2592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4450 -14.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7353 -13.4420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1520 -14.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8591 -14.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5657 -14.2568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5648 -13.4387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8515 -13.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1478 -13.4428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9802 -13.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6868 -13.0240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4892 -13.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7814 -13.0343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4894 -14.2599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0738 -13.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3665 -13.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6594 -13.4409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6592 -14.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3719 -14.6673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0761 -14.2568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7812 -12.2171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 5 1 0
5 23 1 0
23 24 1 0
7 2 1 0
2 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
26 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.61Molecular Weight (Monoisotopic): 478.1926AlogP: 4.60#Rotatable Bonds: 8Polar Surface Area: 83.55Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.96CX Basic pKa: ┄CX LogP: 4.43CX LogD: 4.43Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.51Np Likeness Score: -1.66
References 1. Sasaki Y, Odan M, Yamamoto S, Kida S, Ueyama A, Shimizu M, Haruna T, Watanabe A, Okuno T.. (2018) Discovery of a potent orally bioavailable retinoic acid receptor-related orphan receptor-gamma-t (RORγt) inhibitor, S18-000003., 28 (22): [PMID:30301676 ] [10.1016/j.bmcl.2018.09.032 ]