N1-(2-aminophenyl)-N8-(4-(1-benzyl-1H-1,2,3-triazol-4-yl)phenyl)octanediamide

ID: ALA4293438

PubChem CID: 145988785

Max Phase: Preclinical

Molecular Formula: C29H32N6O2

Molecular Weight: 496.62

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  Nc1ccccc1NC(=O)CCCCCCC(=O)Nc1ccc(-c2cn(Cc3ccccc3)nn2)cc1

Standard InChI:  InChI=1S/C29H32N6O2/c30-25-12-8-9-13-26(25)32-29(37)15-7-2-1-6-14-28(36)31-24-18-16-23(17-19-24)27-21-35(34-33-27)20-22-10-4-3-5-11-22/h3-5,8-13,16-19,21H,1-2,6-7,14-15,20,30H2,(H,31,36)(H,32,37)

Standard InChI Key:  IYKIQDXPWYJSPM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   16.9837  -12.4810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9878  -13.3023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6934  -12.0647    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6892  -11.2434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4006  -10.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3968  -10.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6823   -9.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9703  -10.0236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9776  -10.8428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1138  -11.2397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2739  -12.0719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5641  -12.4882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8502  -12.0791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1405  -12.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4266  -12.0863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4224  -11.2650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7085  -10.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7043  -10.0387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9988  -11.2722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4141   -9.6224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1257  -10.0340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8350   -9.6184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8312   -8.7962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1123   -8.3914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4060   -8.8053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5393   -8.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2920   -8.7093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8349   -8.0944    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4218   -7.3852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6195   -7.5644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7493   -6.6324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5656   -6.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0527   -7.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8682   -7.1160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1965   -6.3626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7073   -5.6986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8934   -5.7922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
  1 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 26  2  0
 23 26  1  0
 29 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4293438

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 496.62

Molecular Weight (Monoisotopic): 496.2587

AlogP: 5.49

#Rotatable Bonds: 12

Polar Surface Area: 114.93

Molecular Species: NEUTRAL

HBA: 6

HBD: 3

#RO5 Violations: 1

HBA (Lipinski): 8

HBD (Lipinski): 4

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 13.56

CX Basic pKa: 3.45

CX LogP: 5.22

CX LogD: 5.22

Aromatic Rings: 4

Heavy Atoms: 37

QED Weighted: 0.18

Np Likeness Score: -1.31

References

1. Adhikari N, Amin SA, Trivedi P, Jha T, Ghosh B..  (2018)  HDAC3 is a potential validated target for cancer: An overview on the benzamide-based selective HDAC3 inhibitors through comparative SAR/QSAR/QAAR approaches.,  157  [PMID:30179749] [10.1016/j.ejmech.2018.08.081]

2. Sangwan R, Rajan R, Mandal PK..  (2018)  HDAC as onco target: Reviewing the synthetic approaches with SAR study of their inhibitors.,  158  [PMID:30245394] [10.1016/j.ejmech.2018.08.073]

3. Sarkar R, Banerjee S, Amin SA, Adhikari N, Jha T..  (2020)  Histone deacetylase 3 (HDAC3) inhibitors as anticancer agents: A review.,  192  [PMID:32163814] [10.1016/j.ejmech.2020.112171]

Source

Source(1):

• Scientific Literature