The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 5-(N-(1,4-dimethyl-7-morpholino-2,3-dioxo-1,2,3,4-tetrahydroquinoxalin-6-yl)sulfamoyl)-3-methylbenzofuran-2-carboxylate ID: ALA4294000
PubChem CID: 46339191
Max Phase: Preclinical
Molecular Formula: C26H28N4O8S
Molecular Weight: 556.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1oc2ccc(S(=O)(=O)Nc3cc4c(cc3N3CCOCC3)n(C)c(=O)c(=O)n4C)cc2c1C
Standard InChI: InChI=1S/C26H28N4O8S/c1-5-37-26(33)23-15(2)17-12-16(6-7-22(17)38-23)39(34,35)27-18-13-20-21(29(4)25(32)24(31)28(20)3)14-19(18)30-8-10-36-11-9-30/h6-7,12-14,27H,5,8-11H2,1-4H3
Standard InChI Key: NJZZSLIBWRZTKN-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
6.8636 -12.7160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1578 -12.3074 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.1568 -13.1229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3412 -13.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9339 -13.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1153 -13.0236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7121 -13.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9343 -14.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1160 -14.4257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7042 -15.1277 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1063 -15.8398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9246 -15.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3409 -15.1390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8871 -15.1210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1581 -15.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6919 -16.5442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3276 -16.5564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7010 -12.3179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1091 -11.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7014 -10.9048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8838 -10.9036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4757 -11.6127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8852 -12.3230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3413 -12.3124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5660 -11.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3831 -11.6039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5594 -10.1922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1557 -10.9003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3808 -10.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7896 -10.8938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5869 -10.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6708 -9.9119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9254 -9.5816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1950 -11.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3778 -9.5021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0862 -9.9096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3765 -8.6849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0835 -8.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0821 -7.4580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
10 14 1 0
13 15 1 0
11 16 2 0
12 17 2 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
6 18 1 0
5 24 1 0
24 2 1 0
2 25 1 0
25 26 2 0
26 30 1 0
29 27 1 0
27 28 2 0
28 25 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 29 1 0
31 34 1 0
32 35 1 0
35 36 2 0
35 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 556.60Molecular Weight (Monoisotopic): 556.1628AlogP: 2.11#Rotatable Bonds: 6Polar Surface Area: 142.08Molecular Species: NEUTRALHBA: 11HBD: 1#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.49CX Basic pKa: ┄CX LogP: 1.69CX LogD: 1.47Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.28Np Likeness Score: -1.40