ethyl 5-(N-(1,4-dimethyl-7-morpholino-2,3-dioxo-1,2,3,4-tetrahydroquinoxalin-6-yl)sulfamoyl)-3-methylbenzofuran-2-carboxylate

ID: ALA4294000

PubChem CID: 46339191

Max Phase: Preclinical

Molecular Formula: C26H28N4O8S

Molecular Weight: 556.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1oc2ccc(S(=O)(=O)Nc3cc4c(cc3N3CCOCC3)n(C)c(=O)c(=O)n4C)cc2c1C

Standard InChI:  InChI=1S/C26H28N4O8S/c1-5-37-26(33)23-15(2)17-12-16(6-7-22(17)38-23)39(34,35)27-18-13-20-21(29(4)25(32)24(31)28(20)3)14-19(18)30-8-10-36-11-9-30/h6-7,12-14,27H,5,8-11H2,1-4H3

Standard InChI Key:  NJZZSLIBWRZTKN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    6.8636  -12.7160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1578  -12.3074    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.1568  -13.1229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3412  -13.7269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9339  -13.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1153  -13.0236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7121  -13.7287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9343  -14.4314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1160  -14.4257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7042  -15.1277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1063  -15.8398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9246  -15.8455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3409  -15.1390    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8871  -15.1210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1581  -15.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6919  -16.5442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3276  -16.5564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7010  -12.3179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1091  -11.6088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7014  -10.9048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8838  -10.9036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4757  -11.6127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8852  -12.3230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3413  -12.3124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5660  -11.6028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3831  -11.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5594  -10.1922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1557  -10.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3808  -10.1883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7896  -10.8938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5869  -10.7230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6708   -9.9119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9254   -9.5816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1950  -11.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3778   -9.5021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0862   -9.9096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3765   -8.6849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0835   -8.2752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0821   -7.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  8  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  9  2  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 10 14  1  0
 13 15  1  0
 11 16  2  0
 12 17  2  0
 18 19  1  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
  6 18  1  0
  5 24  1  0
 24  2  1  0
  2 25  1  0
 25 26  2  0
 26 30  1  0
 29 27  1  0
 27 28  2  0
 28 25  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 29  1  0
 31 34  1  0
 32 35  1  0
 35 36  2  0
 35 37  1  0
 37 38  1  0
 38 39  1  0
M  END

Associated Targets(Human)

BRPF1 Tchem Peregrin (2217 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TRIM24 Tchem Transcription intermediary factor 1-alpha (2087 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 556.60Molecular Weight (Monoisotopic): 556.1628AlogP: 2.11#Rotatable Bonds: 6
Polar Surface Area: 142.08Molecular Species: NEUTRALHBA: 11HBD: 1
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.49CX Basic pKa: CX LogP: 1.69CX LogD: 1.47
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.28Np Likeness Score: -1.40

References

1. Zhu J, Zhou C, Caflisch A..  (2018)  Structure-based discovery of selective BRPF1 bromodomain inhibitors.,  155  [PMID:29902720] [10.1016/j.ejmech.2018.05.037]

Source