The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-(benzyloxy)phenyl)-5-(2,3-dihydrobenzo[b][1,4]dioxane-6-yl)-N-phenyl-4,5-dihydro-1H-pyrazole-1-carbothioamide ID: ALA4294787
PubChem CID: 145993502
Max Phase: Preclinical
Molecular Formula: C31H27N3O3S
Molecular Weight: 521.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: S=C(Nc1ccccc1)N1N=C(c2ccc(OCc3ccccc3)cc2)CC1c1ccc2c(c1)OCCO2
Standard InChI: InChI=1S/C31H27N3O3S/c38-31(32-25-9-5-2-6-10-25)34-28(24-13-16-29-30(19-24)36-18-17-35-29)20-27(33-34)23-11-14-26(15-12-23)37-21-22-7-3-1-4-8-22/h1-16,19,28H,17-18,20-21H2,(H,32,38)
Standard InChI Key: FSKKFHWSKOYZAZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
8.4557 -4.8285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6353 -4.8183 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3695 -5.5945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0263 -6.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6977 -5.6108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8668 -4.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6885 -4.1246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4608 -3.4058 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.6623 -6.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9516 -5.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2419 -6.0174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2486 -6.8343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9592 -7.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6669 -6.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1004 -3.4187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9222 -3.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3368 -2.7134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9308 -2.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1102 -1.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6984 -2.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6038 -7.1018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8947 -6.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8947 -5.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6038 -5.4633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3129 -5.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3129 -6.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1856 -5.4633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4730 -5.8726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4724 -6.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1856 -7.1018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5433 -7.2471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8332 -6.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1279 -7.2556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4215 -6.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7167 -7.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7211 -8.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4362 -8.4851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1381 -8.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
1 5 1 0
6 7 1 0
6 8 2 0
1 6 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
3 9 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
7 15 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
21 26 1 0
27 28 1 0
28 29 2 0
29 30 1 0
22 30 2 0
23 27 2 0
5 28 1 0
12 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.64Molecular Weight (Monoisotopic): 521.1773AlogP: 6.58#Rotatable Bonds: 6Polar Surface Area: 55.32Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.99CX Basic pKa: 1.47CX LogP: 6.78CX LogD: 6.78Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.29Np Likeness Score: -1.08
References 1. Li HL, Su MM, Xu YJ, Xu C, Yang YS, Zhu HL.. (2018) Design and biological evaluation of novel triaryl pyrazoline derivatives with dioxane moiety for selective BRAFV600E inhibition., 155 [PMID:29940463 ] [10.1016/j.ejmech.2018.06.043 ]