The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
HSD-016 ID: ALA4297286
Cas Number: 946396-92-5
PubChem CID: 16721125
Product Number: H648156, Order Now?
Max Phase: Phase
Molecular Formula: C21H21F7N2O3S
Molecular Weight: 514.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: Hsd-016 | HSD-016|946396-92-5|UNII-C4I13768E1|C4I13768E1|(2R)-1,1,1-trifluoro-2-[3-[(2R)-4-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methylpiperazin-1-yl]sulfonylphenyl]propan-2-ol|(R)-1,1,1-Trifluoro-2-(3-(((R)-4-(4-fluoro-2-(trifluoromethyl)phenyl)-2-methylpiperazin-1-yl)sulfonyl)phenyl)propan-2-ol|starbld0030802|SCHEMBL3213640|CHEMBL4297286|DTXSID20241559|ZWASRJHIEFYJGL-BFUOFWGJSA-N|DB12419|MS-29546|HY-122028|NS00073402|Q27275182|BENZENEMETHANOL, 3-(((2R)-4-(4-FLUORO-2-(TRIFLUOROMETHYL)PHENYL)-2 Show More⌵
Canonical SMILES: C[C@@H]1CN(c2ccc(F)cc2C(F)(F)F)CCN1S(=O)(=O)c1cccc([C@@](C)(O)C(F)(F)F)c1
Standard InChI: InChI=1S/C21H21F7N2O3S/c1-13-12-29(18-7-6-15(22)11-17(18)20(23,24)25)8-9-30(13)34(32,33)16-5-3-4-14(10-16)19(2,31)21(26,27)28/h3-7,10-11,13,31H,8-9,12H2,1-2H3/t13-,19-/m1/s1
Standard InChI Key: ZWASRJHIEFYJGL-BFUOFWGJSA-N
Molfile:
RDKit 2D
34 36 0 0 1 0 0 0 0 0999 V2000
7.2076 -3.1634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8605 -4.2039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2858 -5.2895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0582 -5.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4054 -4.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9801 -3.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1779 -4.3392 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.2230 -5.5667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1328 -3.1117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9504 -4.3843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3757 -5.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1482 -5.5150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4953 -4.4745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0701 -3.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2976 -3.3438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8723 -2.2582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7321 -4.5196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3069 -5.6052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5344 -5.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1872 -4.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6126 -3.5242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3850 -3.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4148 -4.6549 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.6540 -6.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5735 -6.6006 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2287 -7.7314 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 -7.6863 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.9386 -6.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9791 -5.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3639 -7.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1364 -7.4608 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.0167 -8.4562 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.7892 -8.5013 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.0242 -6.9047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
5 7 1 0
7 8 2 0
7 9 2 0
7 10 1 0
11 10 1 0
12 11 1 0
13 12 1 0
14 13 1 0
15 14 1 0
10 15 1 0
15 16 1 1
13 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
20 23 1 0
18 24 1 0
24 25 1 0
24 26 1 0
24 27 1 0
3 28 1 0
28 29 1 6
28 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
28 34 1 1
M END
Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: YesAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.46Molecular Weight (Monoisotopic): 514.1161AlogP: 4.51#Rotatable Bonds: 4Polar Surface Area: 60.85Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.58CX Basic pKa: ┄CX LogP: 4.73CX LogD: 4.73Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.61Np Likeness Score: -1.42
References 1. Unpublished dataset, 2. Chuanxin Z, Shengzheng W, Lei D, Duoli X, Jin L, Fuzeng R, Aiping L, Ge Z.. (2020) Progress in 11β-HSD1 inhibitors for the treatment of metabolic diseases: A comprehensive guide to their chemical structure diversity in drug development., 191 [PMID:32088493 ] [10.1016/j.ejmech.2020.112134 ]