The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5'-[N-[(D-Biotinoyl)sulfamoyl]amino-5'-deoxyaristeromycin Triethylammonium Salt ID: ALA4299210
PubChem CID: 145948785
Max Phase: Preclinical
Molecular Formula: C27H46N10O6S2
Molecular Weight: 569.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CC.Nc1ncnc2c1ncn2[C@@H]1C[C@H](CNS(=O)(=O)NC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C21H31N9O6S2.C6H15N/c22-19-16-20(24-8-23-19)30(9-25-16)12-5-10(17(32)18(12)33)6-26-38(35,36)29-14(31)4-2-1-3-13-15-11(7-37-13)27-21(34)28-15;1-4-7(5-2)6-3/h8-13,15,17-18,26,32-33H,1-7H2,(H,29,31)(H2,22,23,24)(H2,27,28,34);4-6H2,1-3H3/t10-,11+,12-,13+,15+,17-,18+;/m1./s1
Standard InChI Key: YJVJRAXZVOJUMD-UTMHFTRDSA-N
Molfile:
RDKit 2D
47 50 0 0 0 0 0 0 0 0999 V2000
9.9256 6.3783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6257 7.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2256 7.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9287 4.8775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5862 6.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2651 6.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9688 4.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.0049 10.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.5183 10.3727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.7275 11.3963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.3364 11.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.6876 12.4936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0476 14.2712 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-8.3208 12.9516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.5046 13.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.5163 9.0134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.8332 12.7535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.5920 12.9204 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-8.4312 11.4527 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-6.2600 11.3664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7723 11.1683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1991 9.7812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7115 9.5831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1383 8.1960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9798 10.5343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6506 7.9979 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.0774 6.6109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1083 9.1072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0810 8.9491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4102 6.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9824 5.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4400 4.6736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5533 3.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1749 2.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1949 3.7514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3547 5.4503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5707 2.5416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9991 -2.7132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 0
2 5 1 0
3 6 1 0
4 7 1 0
9 8 1 0
10 8 1 0
11 9 1 0
12 10 1 0
13 15 1 0
14 11 1 0
15 12 1 0
16 8 2 0
14 17 1 1
12 18 1 6
11 19 1 6
12 11 1 0
13 14 1 0
17 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 0
26 28 2 0
26 29 2 0
27 30 1 0
31 30 1 6
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 31 1 0
32 36 1 1
33 37 1 1
34 38 1 6
38 42 1 0
41 39 1 0
39 40 2 0
40 38 1 0
41 42 2 0
41 46 1 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 47 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 569.67Molecular Weight (Monoisotopic): 569.1839AlogP: -1.63#Rotatable Bonds: 10Polar Surface Area: 226.48Molecular Species: ACIDHBA: 12HBD: 7#RO5 Violations: 3HBA (Lipinski): 15HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 4.14CX Basic pKa: 4.78CX LogP: -3.22CX LogD: -3.79Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.13Np Likeness Score: 0.02
References 1. Bockman MR, Kalinda AS, Petrelli R, De la Mora-Rey T, Tiwari D, Liu F, Dawadi S, Nandakumar M, Rhee KY, Schnappinger D, Finzel BC, Aldrich CC.. (2015) Targeting Mycobacterium tuberculosis Biotin Protein Ligase (MtBPL) with Nucleoside-Based Bisubstrate Adenylation Inhibitors., 58 (18): [PMID:26299766 ] [10.1021/acs.jmedchem.5b00719 ]